CAS 19916-15-5
:6,8-DICHLOROPURINE
Description:
6,8-Dichloropurine is a purine derivative characterized by the presence of two chlorine atoms at the 6 and 8 positions of the purine ring. Its molecular formula is C5H4Cl2N4, indicating that it contains five carbon atoms, four hydrogen atoms, two chlorine atoms, and four nitrogen atoms. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and dimethyl sulfoxide (DMSO). 6,8-Dichloropurine is of interest in biochemical research, particularly in studies related to nucleic acid metabolism and as a potential antiviral agent. Its structure allows it to interact with various biological systems, making it a subject of investigation for its pharmacological properties. Additionally, due to the presence of chlorine substituents, it may exhibit unique reactivity compared to other purine derivatives. Safety data should be consulted for handling, as with many chemical substances, to ensure proper precautions are taken during its use in laboratory settings.
Formula:C5H2Cl2N4
InChI:InChI=1/C5H2Cl2N4/c6-3-2-4(9-1-8-3)11-5(7)10-2/h1-2H
SMILES:C1=NC2=NC(=NC2C(=N1)Cl)Cl
Synonyms:- 6,8-dichloro-5H-purine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
