CAS 19916-73-5: 6-(Phenylmethoxy)-9H-purin-2-amine
Description:6-(Phenylmethoxy)-9H-purin-2-amine, with the CAS number 19916-73-5, is a purine derivative characterized by its structural features that include a purine core substituted with a phenylmethoxy group at the 6-position and an amino group at the 2-position. This compound exhibits properties typical of purines, such as potential biological activity, particularly in relation to nucleic acid metabolism and signaling pathways. It may interact with various biological targets, making it of interest in medicinal chemistry and pharmacology. The presence of the phenylmethoxy group can enhance lipophilicity, potentially influencing its bioavailability and permeability across biological membranes. Additionally, the amino group can participate in hydrogen bonding, which may affect the compound's interactions with enzymes or receptors. Overall, this compound's unique structure suggests it could have applications in drug development, particularly in areas related to cancer research or antiviral therapies, although specific biological activities would need to be evaluated through experimental studies.
Formula:C12H11N5O
InChI:InChI=1S/C12H11N5O/c13-12-16-10-9(14-7-15-10)11(17-12)18-6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H3,13,14,15,16,17)
InChI key:InChIKey=KRWMERLEINMZFT-UHFFFAOYSA-N
SMILES:N1=CNC2=C1N=C(N=C2OCC=3C=CC=CC3)N
- Synonyms:
- 1H-Purin-2-amine, 6-(phenylmethoxy)-
- 2-Amino-6-(benzyloxy)purine
- 2-Amino-6-(phenylmethoxy)-9H-purine
- 2-Amino-6-Benzyloxypurine
- 6-(Phenylmethoxy)-9H-purin-2-amine
- 6-(benzyloxy)-7H-purin-2-amine
- 6-Benzyloxy Guanine
- 6-O-Benzylguanine
- 9H-Purin-2-amine, 6-(phenylmethoxy)-
- Benzylguanine
- See more synonyms
- NSC 637037
- O<sup>6</sup>-Benzylguanine
- Purine, 2-amino-6-(benzyloxy)-
- O-6-Benzylguanine
