CymitQuimica logo

CAS 199172-01-5

:

6-BROMO-3-ETHYL-1H-INDAZOLE

Description:
6-Bromo-3-ethyl-1H-indazole is a chemical compound characterized by its indazole core, which consists of a five-membered ring fused to a six-membered aromatic ring. The presence of a bromine atom at the 6-position and an ethyl group at the 3-position contributes to its unique chemical properties. This compound is typically used in research and development, particularly in medicinal chemistry, due to its potential biological activities. It may exhibit properties such as anti-inflammatory, antimicrobial, or anticancer effects, although specific biological activities can vary based on structural modifications and the context of use. The compound is generally stable under standard laboratory conditions but should be handled with care due to the presence of bromine, which can be reactive. Its solubility characteristics may vary, often being soluble in organic solvents while having limited solubility in water. As with many indazole derivatives, it may serve as a scaffold for further chemical modifications aimed at enhancing its pharmacological profile.
Formula:C9H9BrN2
InChI:InChI=1/C9H9BrN2/c1-2-8-7-4-3-6(10)5-9(7)12-11-8/h3-5H,2H2,1H3,(H,11,12)
InChI key:XZRBYJWQQQBHLP-UHFFFAOYSA-N
SMILES:CCc1c2ccc(cc2n[nH]1)Br
Synonyms:
  • 1H-indazole, 6-bromo-3-ethyl-
  • 6-Bromo-3-ethyl-1H-indazole
Found 2 products.