CAS 199277-80-0

2-[(4S)-4-tert-Butyl-4,5-dihydro-1,3-oxazol-2-yl]-6-methylpyridine

Description:

2-[(4S)-4-tert-Butyl-4,5-dihydro-1,3-oxazol-2-yl]-6-methylpyridine is a chemical compound characterized by its unique structural features, including a pyridine ring substituted with a methyl group and a dihydro-1,3-oxazole moiety. The presence of the tert-butyl group contributes to its steric bulk, influencing its reactivity and solubility. This compound exhibits chirality due to the presence of a stereocenter in the oxazole ring, which can lead to different optical isomers. It is typically used in organic synthesis and may have applications in pharmaceuticals or agrochemicals, given the functional groups present that can participate in various chemical reactions. The compound's properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Overall, its structural complexity and functional groups make it a compound of interest in synthetic organic chemistry.

Formula: C₁₃H₁₈N₂O

InChI: InChI=1/C13H18N2O/c1-9-6-5-7-10(14-9)12-15-11(8-16-12)13(2,3)4/h5-7,11H,8H2,1-4H3/t11-/m1/s1

SMILES: Cc1cccc(C2=N[C@H](CO2)C(C)(C)C)n1

Synonyms:

• pyridine, 2-[(4S)-4-(1,1-dimethylethyl)-4,5-dihydro-2-oxazolyl]-6-methyl-

Pyridine, 2-[(4S)-4-(1,1-dimethylethyl)-4,5-dihydro-2-oxazolyl]-6-methyl-

CAS: 199277-80-0

Formula: C₁₃H₁₈N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 218.2948

Ref: IN-DA002BZT

(S)-4-(tert-Butyl)-2-(6-methylpyridin-2-yl)-4,5-dihydrooxazole

CAS: 199277-80-0

(S)-4-(tert-Butyl)-2-(6-methylpyridin-2-yl)-4,5-dihydrooxazole

Purity: 97%

Molecular weight: 218.29g/mol

Ref: 54-OR83759

(S)-4-(tert-Butyl)-2-(6-methylpyridin-2-yl)-4,5-dihydrooxazole

CAS: 199277-80-0

Purity: 97%

Molecular weight: 218.3000031

Ref: 10-F690885