CAS 199329-67-4: 4-METHYLUMBELLIFERYL-BETA-D-GLUCURONIDE TRIHYDRATE
Description:4-Methylumbelliferyl-β-D-glucuronide trihydrate is a synthetic chemical compound commonly used as a substrate in biochemical assays, particularly for the detection of β-glucuronidase activity. It is a glucuronide derivative of 4-methylumbelliferone, which is a fluorescent compound. The structure of this compound features a glucuronic acid moiety linked to the 4-methylumbelliferone, allowing for the release of the fluorescent 4-methylumbelliferone upon enzymatic hydrolysis by β-glucuronidase. This property makes it valuable in various applications, including enzyme assays and histochemical studies. The trihydrate form indicates that the compound contains three molecules of water, which can influence its solubility and stability. In terms of physical characteristics, it is typically a white to off-white crystalline powder, soluble in water, and exhibits fluorescence under UV light. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C16H22O12
InChI:InChI=1/C16H16O9.3H2O/c1-6-4-10(17)24-9-5-7(2-3-8(6)9)23-16-13(20)11(18)12(19)14(25-16)15(21)22;;;/h2-5,11-14,16,18-20H,1H3,(H,21,22);3*1H2/t11-,12-,13+,14-,16+;;;/m0.../s1
- Synonyms:
- Mug Trihydrate
- MUG
- Mug Hydrate
- 4-Methylumbelliferyl-Beta-D-Glucuronide Hydrate
- 4-Methylumbelliferyl-Beta-D-Glucuronid-Trihydrate
- 4-Methylumbelliferyl-Beta-D-Glucopyranosiduronic Acid Trihydrate
- 4-Methylumbelliferyl-Beta-D-Glucuronic Acid Trihydrate