CAS 199343-14-1
:2-bromo-1-phenylethanol
Description:
2-Bromo-1-phenylethanol is an organic compound characterized by the presence of a bromine atom and a phenyl group attached to a two-carbon alcohol chain. Its molecular structure features a hydroxyl (-OH) group, which imparts alcohol characteristics, making it polar and capable of hydrogen bonding. This compound typically appears as a colorless to pale yellow liquid and has a moderate boiling point due to its molecular weight and the presence of the hydroxyl group. It is soluble in organic solvents and exhibits limited solubility in water, reflecting its hydrophobic phenyl group. The bromine substituent can influence its reactivity, making it a potential candidate for nucleophilic substitution reactions. Additionally, 2-bromo-1-phenylethanol can serve as an intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Safety considerations should be taken into account, as brominated compounds can pose health risks, and appropriate handling and disposal methods should be followed in laboratory settings.
Formula:C8H9BrO
InChI:InChI=1/C8H9BrO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6H2/t8-/m1/s1
SMILES:c1ccc(cc1)[C@@H](CBr)O
Synonyms:- alpha-(Bromomethyl)benzyl alcohol
- (1S)-2-bromo-1-phenylethanol
- 1-Phenyl-2-Bromoethanol
- Aurora Ka-7046
- α-(Bromomethyl)benzenemethanol
- (S)-(+)-2-Bromo-1-Phenylethanol
- (1S)-2-bromo-1-phenyl-ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
