CAS 199396-76-4
:Asoprisnil
Description:
Asoprisnil is a synthetic chemical compound classified as a selective progesterone receptor modulator (SPRM). It is primarily investigated for its potential applications in reproductive health, particularly in the treatment of conditions such as endometriosis and uterine fibroids. Asoprisnil exhibits a unique mechanism of action by selectively binding to progesterone receptors, which can lead to varied effects on target tissues, including inhibition of cell proliferation and modulation of hormonal activity. The compound is characterized by its ability to provide therapeutic benefits while minimizing side effects commonly associated with traditional hormonal therapies. Its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, are crucial for determining its efficacy and safety profile. Research into Asoprisnil continues to explore its potential benefits and risks, contributing to the understanding of SPRMs in clinical applications. As with any pharmaceutical agent, ongoing studies are essential to fully elucidate its characteristics and therapeutic potential.
Formula:C28H35NO4
InChI:InChI=1S/C28H35NO4/c1-27-15-24(19-6-4-18(5-7-19)16-29-31)26-22-11-9-21(30)14-20(22)8-10-23(26)25(27)12-13-28(27,33-3)17-32-2/h4-7,14,16,23-25,31H,8-13,15,17H2,1-3H3/b29-16+/t23-,24+,25-,27-,28+/m0/s1
InChI key:InChIKey=GJMNAFGEUJBOCE-MEQIQULJSA-N
SMILES:C[C@@]12[C@]([C@]3(C([C@H](C1)C4=CC=C(/C=N/O)C=C4)=C5C(CC3)=CC(=O)CC5)[H])(CC[C@]2(COC)OC)[H]
Synonyms:- (11β,17β)-11-{4-[(E)-(hydroxyimino)methyl]phenyl}-17-methoxy-17-(methoxymethyl)estra-4,9-dien-3-one
- 11beta-(4-((E)-(Hydroxyimino)methyl)phenyl)-17beta-methoxy-17-(methoxymethyl)estra-4,9-dien-3-one
- Asoprisnil
- Asoprisnil [USAN]
- Benzaldehyde, 4-((11beta,17beta)-17-methoxy-17-(methoxymethyl)-3-oxoestra-4,9-dien-11-yl)-, 1-oxime, (C(E))-
- Benzaldehyde, 4-[(11β,17β)-17-methoxy-17-(methoxymethyl)-3-oxoestra-4,9-dien-11-yl]-, 1-oxime, [C(E)]-
- J 867
- J867
- Unii-72W09924Wp
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Benzaldehyde, 4-[(11β,17β)-17-methoxy-17-(methoxymethyl)-3-oxoestra-4,9-dien-11-yl]-, 1-oxime, [C(E)]-
CAS:Formula:C28H35NO4Molecular weight:449.5818O-Desmethyl-asoprisnil-15N,d3
CAS:Controlled ProductFormula:C27D3H3015NO4Color and Shape:NeatMolecular weight:439.567Asoprisnil
CAS:Controlled ProductAsoprisnil is a synthetic steroidal compound that exhibits a variety of characteristics. It has been found to have anti-inflammatory properties and can inhibit the production of prostaglandins, which are responsible for inflammation in the body. Additionally, Asoprisnil has shown potential in inhibiting the growth of certain bacteria, such as Clostridium perfringens. It achieves this by interfering with bacterial DNA gyrase and topoisomerase IV, enzymes crucial for maintaining the integrity of bacterial DNA. However, it should be noted that Asoprisnil is not effective against acid-fast bacteria like Mycobacterium tuberculosis or Mycobacterium avium complex.Formula:C28H35NO4Purity:Min. 95%Molecular weight:449.58 g/molAsoprisnil
CAS:Asoprisnil is a selective modulator of progesterone receptor.Formula:C28H35NO4Purity:98%Color and Shape:SolidMolecular weight:449.58
![Benzaldehyde, 4-[(11β,17β)-17-methoxy-17-(methoxymethyl)-3-oxoestra-4,9-dien-11-yl]-, 1-oxime, [C(…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2FIN%2Fthumb%2FDA002C39.jpg&w=3840&q=75)
