CAS 199444-11-6
:IR-775 CHLORIDE
Description:
IR-775 Chloride, with the CAS number 199444-11-6, is a synthetic compound primarily studied for its potential applications in the field of photodynamic therapy and as a photosensitizer in cancer treatment. This substance is characterized by its ability to absorb light and subsequently produce reactive oxygen species, which can induce cell death in targeted cancer cells upon activation by specific wavelengths of light. IR-775 Chloride is typically a solid at room temperature and exhibits solubility in organic solvents, making it suitable for various formulations in research and therapeutic contexts. Its chemical structure includes a chlorinated moiety, which contributes to its photophysical properties. Safety and handling precautions are essential when working with this compound, as it may pose risks associated with its reactive nature and potential toxicity. Ongoing research continues to explore its efficacy and safety profile in clinical applications, highlighting its significance in advancing cancer treatment methodologies.
Formula:C32H36ClN2Cl
InChI:InChI=1S/C32H36ClN2.ClH/c1-31(2)24-14-7-9-16-26(24)34(5)28(31)20-18-22-12-11-13-23(30(22)33)19-21-29-32(3,4)25-15-8-10-17-27(25)35(29)6;/h7-10,14-21H,11-13H2,1-6H3;1H/q+1;/p-1
InChI key:BPSIJFMUSNMMAL-UHFFFAOYSA-M
SMILES:CC1(C2=CC=CC=C2[N+](=C1C=CC3=C(C(=CC=C4C(C5=CC=CC=C5N4C)(C)C)CCC3)Cl)C)C.[Cl-]
Synonyms:- 2-[2-[2-Chloro-3-[2-(1,3-Dihydro-1,3,3-Trimethyl-2H-Indol-2-Ylidene)-Ethylidene]-1-Cyclohexen-1-Yl]-Ethenyl]-1,3,3-Trimethyl-3H-Indolium Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
IR 775 Chloride
CAS:Formula:C32H36Cl2N2Purity:>90.0%(N)Color and Shape:Green to Dark green powder to crystalMolecular weight:519.55IR-775 chloride, 90% dye content
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C32H36Cl2N2Purity:90%Molecular weight:519.552-(2-(2-Chloro-3-(2-(1,3,3-TrimethylIndolin-2-Ylidene)ethYlidene)Cyclohex-1-en-1-yl)Vinyl)-1,3,3-Trimethyl-3H-Indol-1-Ium Chloride
CAS:Formula:C32H36Cl2N2Purity:95%Color and Shape:SolidMolecular weight:519.54762-(2-(2-Chloro-3-(2-(1,3,3-TrimethylIndolin-2-Ylidene)ethYlidene)Cyclohex-1-en-1-yl)Vinyl)-1,3,3-Trimethyl-3H-Indol-1-Ium Chloride
CAS:2-(2-(2-Chloro-3-(2-(1,3,3-TrimethylIndolin-2-Ylidene)ethYlidene)Cyclohex-1-en-1-yl)Vinyl)-1,3,3-Trimethyl-3H-Indol-1-Ium ChlorideFormula:C32H36Cl2N2Purity:Dye content ~90 %Molecular weight:519.55IR-775 chloride
CAS:2-(2-(2-Chloro-3-(2-(1,3,3-trimethylindolin-2-ylidene)ethylidene)cyclohex-1-en-1-yl)vinyl)-1,3,3-trimethyl-3H-indol-1-ium chlorideFormula:C32H36Cl2N2Purity:95%Molecular weight:519.55IR-775 chloride
CAS:IR-775 chloride is a fluorescent agent that can be used for both diagnostic and therapeutic purposes. It is used in the detection of cells, proteins, and nucleic acids. IR-775 chloride has a hydrophobic nature, which allows it to bind to molecules that are hydrophobic themselves. It can also be used as a ligand for the attachment of other molecules with complementary properties, such as β-cyclodextrin, which is an example of a heterobifunctional molecule. This property gives IR-775 chloride an advantage over other fluorescent agents due to its ability to transport molecules through cell membranes. The diameter of IR-775 chloride is approximately 10 nm, making it useful in microscopy techniques such as fluorescence microscopy and confocal microscopy.Formula:C32H36Cl2N2Purity:Min. 98 Area-%Color and Shape:Green PowderMolecular weight:519.55 g/mol3H-Indolium, 2-[2-[2-chloro-3-[2-(1,3-dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)ethylidene]-1-cyclohexen-1-yl]ethenyl]-1,3,3-trimethyl-, chloride (1:1)
CAS:Purity:98%Color and Shape:SolidMolecular weight:519.55






