CymitQuimica logo

CAS 199538-99-3

:

tert-Butyl 4-(prop-2-ynyl)piperazine-1-carboxylate

Description:
Tert-Butyl 4-(prop-2-ynyl)piperazine-1-carboxylate is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a tert-butyl group, providing steric bulk and enhancing lipophilicity, which can influence its solubility and biological activity. The presence of a prop-2-ynyl substituent introduces an alkyne functional group, which can participate in various chemical reactions, including click chemistry and other coupling reactions. The carboxylate moiety contributes to the compound's potential as a building block in organic synthesis and medicinal chemistry. Its structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting neurological or psychiatric conditions, given the role of piperazine derivatives in drug design. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H20N2O2
InChI:InChI=1/C12H20N2O2/c1-5-6-13-7-9-14(10-8-13)11(15)16-12(2,3)4/h1H,6-10H2,2-4H3
InChI key:OAXARSVKYJPDPA-UHFFFAOYSA-N
SMILES:C#CCN1CCN(CC1)C(=O)OC(C)(C)C
Synonyms:
  • 199538-99-3
  • Tert-Butyl 4-(Prop-2-Yn-1-Yl)Piperazine-1-Carboxylate
Found 5 products.