CymitQuimica logo

CAS 19956-76-4

:

2,2',3,3',5,5'-hexamethyl-(1,1'-bi-phenyl)-4,4'-D

Description:
2,2',3,3',5,5'-Hexamethyl-(1,1'-bi-phenyl)-4,4'-D, with the CAS number 19956-76-4, is a chemical compound characterized by its complex structure, which includes two biphenyl units substituted with multiple methyl groups. This compound is part of the family of biaryl compounds, known for their applications in organic synthesis and materials science. The presence of six methyl groups enhances its solubility and alters its physical properties, such as melting and boiling points, compared to its unsubstituted counterparts. Additionally, the methyl substitutions can influence the compound's electronic properties, potentially affecting its reactivity and stability. It may exhibit interesting optical properties due to its conjugated system, making it a candidate for use in organic electronics or as a dye. The compound's synthesis typically involves multi-step organic reactions, and its characterization can be performed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many organic compounds, safety precautions should be observed when handling this substance.
Formula:C18H22O2
InChI:InChI=1/C18H22O2/c1-9-7-15(11(3)13(5)17(9)19)16-8-10(2)18(20)14(6)12(16)4/h7-8,19-20H,1-6H3
InChI key:IOJCFCLZQBXCIQ-UHFFFAOYSA-N
SMILES:Cc1cc(c(C)c(C)c1O)c1cc(C)c(c(C)c1C)O
Synonyms:
  • 2,2',3,3',5,5'-Hexamethylbiphenyl-4,4'-Diol
Found 4 products.