CAS 19959-71-8
:4-(1H-PYRAZOL-4-YL)PYRIDINE
Description:
4-(1H-Pyrazol-4-yl)pyridine, with the CAS number 19959-71-8, is an organic compound characterized by its heterocyclic structure, which features both a pyridine and a pyrazole ring. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of various pharmaceuticals and agrochemicals. The presence of both nitrogen-containing rings contributes to its unique chemical reactivity and biological activity. The compound is generally soluble in polar organic solvents, which facilitates its use in various chemical reactions. Its properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Additionally, 4-(1H-pyrazol-4-yl)pyridine may exhibit interesting interactions with biological targets, making it a subject of interest in drug discovery and development. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C8H7N3
InChI:InChI=1/C8H7N3/c1-3-9-4-2-7(1)8-5-10-11-6-8/h1-6H,(H,10,11)
SMILES:c1cnccc1c1c[nH]nc1
Synonyms:- Pyridine, 4-(1H-pyrazol-4-yl)-
- 4-(1H-Pyrazol-4-yl)pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyridine, 4-(1H-pyrazol-4-yl)-
CAS:Formula:C8H7N3Purity:95%Color and Shape:SolidMolecular weight:145.16134-(1H-Pyrazol-4-yl)pyridine
CAS:4-(1H-Pyrazol-4-yl)pyridineFormula:C8H7N3Purity:95%Color and Shape: off-white solidMolecular weight:145.16g/mol4-(1H-Pyrazol-4-yl)pyridine
CAS:Formula:C8H7N3Purity:98%Color and Shape:SolidMolecular weight:145.1654-(1H-Pyrazol-4-yl)pyridine
CAS:4-(1H-Pyrazol-4-yl)pyridine is a supramolecular compound that has been shown to be metastable. It can be used as a selective adsorbent for the uptake of metal ions from solutions. 4-(1H-Pyrazol-4-yl)pyridine can also be used to remove xylene from water and other liquids, producing nonporous crystals that are stable and easy to handle. The molecular structure of 4-(1H-pyrazol-4-yl)pyridine has been studied by X-ray diffraction, which revealed its high degree of order and stability.
Formula:C8H7N3Purity:Min. 95%Molecular weight:145.16 g/mol



