CymitQuimica logo

CAS 199612-75-4

:

4-(1-Pyrenyl)butyryl-Phe-OH

Description:
4-(1-Pyrenyl)butyryl-Phe-OH, identified by its CAS number 199612-75-4, is a chemical compound that features a pyrene moiety, which is a polycyclic aromatic hydrocarbon known for its fluorescence properties. This compound is characterized by its butyryl group linked to a phenylalanine (Phe) residue, which contributes to its potential biological activity and solubility characteristics. The presence of the pyrene group often indicates applications in fluorescence-based assays or as a probe in biochemical studies due to its strong light absorption and emission properties. Additionally, the structure suggests that it may interact with biological macromolecules, making it of interest in drug design and development. The compound's stability, solubility, and reactivity can be influenced by the surrounding environment, such as pH and solvent polarity. Overall, 4-(1-Pyrenyl)butyryl-Phe-OH is a compound of interest in both synthetic chemistry and biochemistry, particularly in studies involving molecular interactions and fluorescence applications.
Formula:C29H25NO3
InChI:InChI=1/C29H25NO3/c31-26(30-25(29(32)33)18-19-6-2-1-3-7-19)11-5-8-20-12-13-23-15-14-21-9-4-10-22-16-17-24(20)28(23)27(21)22/h1-4,6-7,9-10,12-17,25H,5,8,11,18H2,(H,30,31)(H,32,33)/t25-/m0/s1
SMILES:c1ccc(cc1)C[C@@H](C(=O)O)N=C(CCCc1ccc2ccc3cccc4ccc1c2c34)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.