
CAS 199655-36-2
:3-(2-Chlorophenyl)-2-[2-[6-[(diethylamino)methyl]-2-pyridinyl]ethenyl]-6-fluoro-4(3H)-quinazolinonehydrochloride
Description:
3-(2-Chlorophenyl)-2-[2-[6-[(diethylamino)methyl]-2-pyridinyl]ethenyl]-6-fluoro-4(3H)-quinazolinone hydrochloride, with CAS number 199655-36-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinazolinone core, a chlorophenyl group, and a diethylamino-substituted pyridine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. The presence of halogen atoms, such as chlorine and fluorine, often enhances the compound's pharmacological properties and influences its interaction with biological targets. Additionally, the diethylamino group may contribute to its lipophilicity, affecting its absorption and distribution in biological systems. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity, and its use would be governed by regulatory guidelines in research and development contexts.
Formula:C26H24ClFN4O
InChI:InChI=1S/C26H24ClFN4O/c1-3-31(4-2)17-20-9-7-8-19(29-20)13-15-25-30-23-14-12-18(28)16-21(23)26(33)32(25)24-11-6-5-10-22(24)27/h5-16H,3-4,17H2,1-2H3/b15-13+
InChI key:HYHNPUGUPISSQO-FYWRMAATSA-N
SMILES:CCN(CC)CC1=NC(=CC=C1)/C=C/C2=NC3=C(C=C(C=C3)F)C(=O)N2C4=CC=CC=C4Cl
Synonyms:- 4(3H)-Quinazolinone, 3-(2-chlorophenyl)-2-[2-[6-[(diethylamino)methyl]-2-pyridinyl]ethenyl]-6-fluoro-
- 3-(2-Chlorophenyl)-2-[2-[6-[(diethylamino)methyl]-2-pyridinyl]ethenyl]-6-fluoro-4(3H)-quinazolinone
- CP465022; CP-465022
- CP 465022 hydrochloride
- CP465022HCl
- CP 465022 hydrochloride,3-(2-Chlorophenyl)-2-[2-[6-[(diethylamino)methyl]-2-pyridinyl]ethenyl]-6-fluoro-4(3H)-quinazolinonehydrochloride
- 3-(2-Chlorophenyl)-2-[2-[6-[(diethylamino)methyl]-2-pyridinyl]ethenyl]-6-fluoro-4(3H)-quinazolinonehydrochloride
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4(3H)-Quinazolinone, 3-(2-chlorophenyl)-2-[2-[6-[(diethylamino)methyl]-2-pyridinyl]ethenyl]-6-fluoro-
CAS:Formula:C26H24ClFN4OPurity:%Color and Shape:SolidMolecular weight:462.9464CP 465022
CAS:CP 465022 hydrochloride is a potent AMPA receptor antagonist with anti-seizure properties, inhibiting responses at an IC50 of 25 nM.Formula:C26H24ClFN4OPurity:99.05%Color and Shape:SolidMolecular weight:462.95CP-465022
CAS:3-(2-Chlorophenyl)-2-(2-(6-((diethylamino)methyl)pyridin-2-yl)vinyl)-6-fluoroquinazolin-4(3H)-oneFormula:C26H24ClFN4OPurity:99+%Molecular weight:462.95CP 465022
CAS:Controlled ProductCP 465022 is a controlled product that is widely used in various industries. It is a versatile compound with a range of applications, including as a viscosity modifier, photocatalytic agent, and biomass catalyst. CP 465022 is particularly effective in the production of biodiesel and has been found to enhance the performance of cephalosporins, alkaloids, polymers, and electrodes. Additionally, CP 465022 has been shown to have inhibitory effects on crystallization and crotonic acid formation. Its unique properties make it an essential ingredient in many industrial processes. With its ability to improve efficiency and quality, CP 465022 is an invaluable component for businesses across different sectors.
Formula:C26H25Cl2FN4OPurity:Min. 95%Molecular weight:499.41 g/mol





