CAS 199678-12-1

4-(Pyrimidin-2-yl)benzoic acid

Description:

4-(Pyrimidin-2-yl)benzoic acid, with the CAS number 199678-12-1, is an organic compound characterized by its structure, which features a benzoic acid moiety substituted with a pyrimidine ring. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. It is known for its role in medicinal chemistry and as a building block in the synthesis of various pharmaceuticals due to its ability to interact with biological targets. The presence of both the carboxylic acid group and the pyrimidine ring contributes to its acidic and polar characteristics, influencing its reactivity and interactions in chemical processes. Additionally, 4-(Pyrimidin-2-yl)benzoic acid may exhibit biological activity, making it of interest in drug development and research. Its molecular structure allows for potential hydrogen bonding and π-π stacking interactions, which can be significant in biological systems and material science applications.

Formula: C₁₁H₈N₂O₂

InChI: InChI=1/C11H8N2O2/c14-11(15)9-4-2-8(3-5-9)10-12-6-1-7-13-10/h1-7H,(H,14,15)

SMILES: c1cnc(c2ccc(cc2)C(=O)O)nc1

Synonyms:

• Akos Bar-2339
• Benzoic acid, 4-(2-pyrimidinyl)- (9CI)
• 4-Pyrimidin-2-yl-benzoicacid95%

Benzoic acid, 4-(2-pyrimidinyl)-

CAS: 199678-12-1

Formula: C₁₁H₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 200.1934

Ref: IN-DA002C9L

4-(Pyrimidin-2-yl)benzoic acid

CAS: 199678-12-1

4-(Pyrimidin-2-yl)benzoic acid

Formula: C₁₁H₈N₂O₂

Purity: 95%

Color and Shape: Powder

Molecular weight: 200.19g/mol

Ref: 54-OR6232

4-(Pyrimidin-2-yl)benzoic acid

CAS: 199678-12-1

Formula: C₁₁H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 200.197

Ref: 10-F065750