
CAS 199684-60-1
:α-Cyclodextrin, dihydrogen phosphate, sodium salt
Description:
α-Cyclodextrin, dihydrogen phosphate, sodium salt is a derivative of α-cyclodextrin, a cyclic oligosaccharide composed of six glucose units linked by α-1,4-glycosidic bonds. This compound is characterized by its ability to form inclusion complexes, which enhances the solubility and stability of various guest molecules, making it valuable in pharmaceutical and food applications. The dihydrogen phosphate group introduces acidic properties, while the sodium salt form improves its solubility in aqueous solutions. This compound exhibits low toxicity and is generally recognized as safe for use in food and drug formulations. Its unique structure allows it to encapsulate hydrophobic compounds, facilitating their delivery and bioavailability. Additionally, α-cyclodextrin derivatives are known for their ability to modulate the release of active ingredients, making them useful in controlled-release formulations. Overall, α-cyclodextrin, dihydrogen phosphate, sodium salt is a versatile compound with significant applications in various fields, including pharmaceuticals, food science, and biotechnology.
Formula:C36H60O30·xH3O4P·xNa
InChI:InChI=1S/C36H60O30.Na.H3O4P/c37-1-7-25-13(43)19(49)31(55-7)62-26-8(2-38)57-33(21(51)15(26)45)64-28-10(4-40)59-35(23(53)17(28)47)66-30-12(6-42)60-36(24(54)18(30)48)65-29-11(5-41)58-34(22(52)16(29)46)63-27-9(3-39)56-32(61-25)20(50)14(27)44;;1-5(2,3)4/h7-54H,1-6H2;;(H3,1,2,3,4)/t7-,8-,9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-;;/m1../s1
InChI key:InChIKey=OJKWLEYAGUPSEW-RUDABQCWSA-N
SMILES:C(O)[C@@H]1[C@@]2([C@H](O)[C@@H](O)[C@](O1)(O[C@@]3([C@@H](CO)O[C@@]([C@H](O)[C@H]3O)(O[C@@]4([C@@H](CO)O[C@@]([C@H](O)[C@H]4O)(O[C@]5([C@H](O)[C@@H](O)[C@@](O[C@]6([C@H](O)[C@@H](O)[C@@](O[C@]7([C@H](O)[C@@H](O)[C@@](O2)(O[C@@H]7CO)[H])[H])(O[C@@H]6CO)[H])[H])(O[C@@H]5CO)[H])[H])[H])[H])[H])[H])[H])[H].P(=O)(O)(O)O.[Na]
Synonyms:- Alpha-Cyclodextrin Dihydrogen Phosphate Sodium Salt
- Sodium α-cyclodextrin phosphate
- Α-Cyclodextrin Phosphate Sodium Salt
- α-Cyclodextrin, dihydrogen phosphate, sodium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
a-Cyclodextrin dihydrogen phosphate sodium salt
CAS:Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.Formula:C36H60O30Purity:Min. 95%Molecular weight:972.84 g/mol

