
CAS 199684-62-3
:gamma-Cyclodextrin dihydrogen phosphate sodium salt
Description:
Gamma-Cyclodextrin dihydrogen phosphate sodium salt is a modified cyclodextrin, which is a cyclic oligosaccharide composed of seven glucose units. This compound is characterized by its ability to form inclusion complexes with various guest molecules, enhancing their solubility and stability. The dihydrogen phosphate modification introduces phosphate groups, which can improve the compound's solubility in aqueous environments and provide additional functional properties. As a sodium salt, it is typically more soluble in water compared to its non-salt forms. Gamma-Cyclodextrin itself has a larger cavity size compared to alpha and beta-cyclodextrins, allowing it to encapsulate larger hydrophobic molecules. This property makes it valuable in pharmaceutical applications, food technology, and cosmetics, where it can enhance the delivery and bioavailability of active ingredients. Additionally, its biocompatibility and low toxicity make it suitable for various applications in drug formulation and delivery systems. Overall, gamma-Cyclodextrin dihydrogen phosphate sodium salt is a versatile compound with significant potential in multiple industries.
Formula:C48H80O40·x(H3PO4)·xNa
InChI:InChI=1S/C48H80O40.Na.H3O4P/c49-1-9-33-17(57)25(65)41(73-9)82-34-10(2-50)75-43(27(67)19(34)59)84-36-12(4-52)77-45(29(69)21(36)61)86-38-14(6-54)79-47(31(71)23(38)63)88-40-16(8-56)80-48(32(72)24(40)64)87-39-15(7-55)78-46(30(70)22(39)62)85-37-13(5-53)76-44(28(68)20(37)60)83-35-11(3-51)74-42(81-33)26(66)18(35)58;;1-5(2,3)4/h9-72H,1-8H2;;(H3,1,2,3,4)/t9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,45-,46-,47-,48-;;/m1../s1
InChI key:InChIKey=MIESYCOVIRDVSC-NTVOSJKKSA-N
SMILES:C(O)[C@@H]1[C@@]2([C@H](O)[C@@H](O)[C@](O1)(O[C@@]3([C@@H](CO)O[C@@]([C@H](O)[C@H]3O)(O[C@@]4([C@@H](CO)O[C@@]([C@H](O)[C@H]4O)(O[C@@]5([C@@H](CO)O[C@@]([C@H](O)[C@H]5O)(O[C@]6([C@H](O)[C@@H](O)[C@@](O[C@]7([C@H](O)[C@@H](O)[C@@](O[C@]8([C@H](O)[C@@H](O)[C@@](O[C@]9([C@H](O)[C@@H](O)[C@@](O2)(O[C@@H]9CO)[H])[H])(O[C@@H]8CO)[H])[H])(O[C@@H]7CO)[H])[H])(O[C@@H]6CO)[H])[H])[H])[H])[H])[H])[H])[H])[H])[H].P(=O)(O)(O)O.[Na]
Synonyms:- G-Cyclodextrin Phosphate Sodium Salt
- Sodium Gamma-Cyclodextrin Phosphate
- Sodium γ-cyclodextrin phosphate
- γ-Cyclodextrin, dihydrogen phosphate, sodium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
gamma-Cyclodextrin dihydrogen phosphate sodium salt
CAS:<p>This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.</p>Formula:C48H80O40Purity:Min. 95%Molecular weight:1,297.12 g/mol

