CAS 199725-38-7

Ethyl cis-1,3,4,4a,5,9b-hexahydro-2H-pyrido[4,3-b]indole-2-carboxylate

Description:

Ethyl cis-1,3,4,4a,5,9b-hexahydro-2H-pyrido[4,3-b]indole-2-carboxylate, identified by its CAS number 199725-38-7, is a chemical compound characterized by its complex bicyclic structure that incorporates both pyridine and indole moieties. This compound features a hexahydro configuration, indicating the presence of multiple saturated carbon atoms within its ring system, which contributes to its stability and potential biological activity. The ethyl ester functional group suggests that it may exhibit solubility in organic solvents and could participate in various chemical reactions typical of esters. Its structural features may impart specific pharmacological properties, making it of interest in medicinal chemistry and drug development. The compound's stereochemistry, particularly the cis configuration, can influence its interaction with biological targets, potentially affecting its efficacy and safety profile. Overall, this compound represents a unique structure that may have applications in pharmaceuticals or as a research chemical, although specific biological activities and applications would require further investigation.

Formula: C₁₄H₁₈N₂O₂

InChI: InChI=1/C14H18N2O2/c1-2-18-14(17)16-8-7-13-11(9-16)10-5-3-4-6-12(10)15-13/h3-6,11,13,15H,2,7-9H2,1H3/t11-,13-/m1/s1

SMILES: CCOC(=O)N1CC[C@@H]2[C@H](C1)c1ccccc1N2

Synonyms:

• cis-1,3,4,4a,5,9b-Hexahydro-2H-pyrido[4,3-b]indole-2-carboxylic acid ethyl ester
• 1,3,4A,5,9B-Hexahydro,Ethyl Ester,2H-Pyrido[4,3-B]Indole-2-Carboxylic Acid
• 2H-Pyrido[4,3,B]Indole-2-Carboxylic Acid
• 2H-Pyrido[4,3,b]indole-2-carboxylic acid,1,3,4,4a,5,9b-hexahydro-,ethyl ester
• Ethyl3,4,4a,5-tetrahydro-1h-pyrido[4,3-b]indole-2(9bh)-carboxylate