
CAS 1997286-65-3
:12-[(1-Oxohexadecyl)oxy]octadecanoic acid
Description:
12-[(1-Oxohexadecyl)oxy]octadecanoic acid, also known by its CAS number 1997286-65-3, is a synthetic fatty acid derivative characterized by a long hydrocarbon chain. This compound features a carboxylic acid functional group, which imparts its acidic properties, and an ether linkage due to the presence of the hexadecyl moiety. The structure suggests that it has both hydrophobic and hydrophilic characteristics, making it amphiphilic. Such properties can facilitate its use in various applications, including as a surfactant or emulsifier in formulations. The presence of the long alkyl chains typically enhances its solubility in organic solvents while limiting its solubility in water. Additionally, the compound may exhibit biological activity, potentially influencing cell membrane dynamics or serving as a precursor in the synthesis of more complex molecules. Its stability and reactivity can be influenced by environmental factors such as temperature and pH, which are important considerations in its practical applications. Overall, this compound represents a class of fatty acid derivatives with potential utility in both industrial and pharmaceutical contexts.
Formula:C34H66O4
InChI:InChI=1S/C34H66O4/c1-3-5-7-9-10-11-12-13-14-15-20-23-27-31-34(37)38-32(28-24-8-6-4-2)29-25-21-18-16-17-19-22-26-30-33(35)36/h32H,3-31H2,1-2H3,(H,35,36)
InChI key:InChIKey=XXHBLSWAKHZVLN-UHFFFAOYSA-N
SMILES:C(OC(CCCCCCCCCCCCCCC)=O)(CCCCCCCCCCC(O)=O)CCCCCC
Synonyms:- 12-PAHSA
- Octadecanoic acid, 12-[(1-oxohexadecyl)oxy]-
- 12-[(1-Oxohexadecyl)oxy]octadecanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
12-PAHSA
CAS:FAHFAs, like 12-PAHSA in AG4OX mice's adipose tissue, are fatty acid esters tied to insulin sensitivity, affected by diet and fasting.Formula:C34H66O4Color and Shape:SolidMolecular weight:538.89812-PAHSA
CAS:12-PAHSA is a bioactive lipid molecule, which is a member of the family of fatty acid esters of hydroxy fatty acids. It is derived from natural sources, including various tissues in mammals, where it is synthesized endogenously. This compound functions through mechanisms involving the modulation of inflammatory pathways and metabolic processes. It is known to enhance insulin sensitivity, reduce inflammation, and improve glucose tolerance, making it relevant in the context of metabolic disorders.Formula:C34H66O4Purity:Min. 95%Molecular weight:538.9 g/mol

