CAS 1998-61-4

4-BROMOTETRAFLUOROPHENOL

Description:

4-Bromotetrafluorophenol is an organic compound characterized by the presence of a bromine atom and four fluorine atoms attached to a phenolic ring. Its molecular structure features a hydroxyl group (-OH) that contributes to its classification as a phenol. The presence of multiple electronegative fluorine atoms significantly influences its chemical properties, enhancing its acidity compared to non-fluorinated phenols. This compound is typically a solid at room temperature and is known for its potential applications in various fields, including materials science and organic synthesis. It exhibits strong hydrogen bonding capabilities due to the hydroxyl group, which can affect its solubility in different solvents. Additionally, the bromine substituent can introduce unique reactivity patterns, making it a useful intermediate in the synthesis of more complex organic molecules. Safety precautions should be observed when handling this compound, as it may pose health risks, including irritation to the skin and respiratory system. Overall, 4-bromotetrafluorophenol is a valuable compound in chemical research and industrial applications.

Formula: C₆HBrF₄O

InChI: InChI=1/C6HBrF4O/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H

SMILES: c1(c(c(c(c(c1F)F)O)F)F)Br

Synonyms:

• 4-Bromo-2,3,5,6-Tetrafluorophenol

Phenol, 4-bromo-2,3,5,6-tetrafluoro-

CAS: 1998-61-4

Formula: C₆HBrF₄O

Purity: 95%

Color and Shape: Solid

Molecular weight: 244.9692

Ref: IN-DA002CCP

4-Bromo-2,3,5,6-tetrafluorophenol

CAS: 1998-61-4

4-Bromo-2,3,5,6-tetrafluorophenol

Formula: C₆HBrF₄O

Purity: 96%

Color and Shape: yellow solid

Molecular weight: 244.97g/mol

Ref: 54-PC10598

4-Bromotetrafluorophenol

CAS: 1998-61-4

Formula: C₆HBrF₄O

Purity: 95%

Molecular weight: 244.971

Ref: 10-F024410