CAS 199804-81-4
:Ethanone, 2-bromo-1-(2-thiazolyl)-, hydrobromide
Description:
Ethanone, 2-bromo-1-(2-thiazolyl)-, hydrobromide, with the CAS number 199804-81-4, is a chemical compound characterized by its thiazole ring and bromine substituent. It is a hydrobromide salt, indicating that it is typically encountered in a protonated form, which enhances its solubility in polar solvents. The presence of the thiazole moiety suggests potential biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. The compound may exhibit properties such as antimicrobial or antifungal activity, although specific biological effects would depend on its structure and interactions. In terms of physical properties, it is likely to be a solid at room temperature, with a melting point that can vary based on purity and crystalline form. Safety data should be consulted for handling, as halogenated compounds can pose risks such as toxicity or environmental hazards. Overall, this compound's unique structure and properties make it of interest in both synthetic chemistry and potential applications in medicinal chemistry.
Formula:C5H4BrNOS・BrH
InChI:InChI=1S/C5H4BrNOS.BrH/c6-3-4(8)5-7-1-2-9-5;/h1-2H,3H2;1H
InChI key:HLJSDOINJDEVKV-UHFFFAOYSA-N
SMILES:C1=CSC(=N1)C(=O)CBr.Br
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Bromo-1-(thiazol-2-yl)ethanone hydrobromide
CAS:Formula:C5H5Br2NOSColor and Shape:SolidMolecular weight:286.9723
