CAS 19983-42-7

6-nitro-1-benzothiophene-2-carboxylic acid

Description:

6-Nitro-1-benzothiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzothiophene ring system substituted with a nitro group and a carboxylic acid functional group. This compound typically exhibits a yellow to orange color and is soluble in polar organic solvents. The presence of the nitro group contributes to its potential as a reactive intermediate in various chemical reactions, while the carboxylic acid group can participate in acid-base chemistry and form salts or esters. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its reactivity and solubility. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature. Overall, 6-nitro-1-benzothiophene-2-carboxylic acid serves as a valuable building block in organic synthesis and materials science.

Formula: C₉H₅NO₄S

InChI: InChI=1/C9H5NO4S/c11-9(12)8-3-5-1-2-6(10(13)14)4-7(5)15-8/h1-4H,(H,11,12)

SMILES: c1cc(cc2c1cc(C(=O)O)s2)N(=O)=O

6-Nitrobenzo[b]thiophene-2-carboxylic acid

CAS: 19983-42-7

Formula: C₉H₅NO₄S

Molecular weight: 223.2053

Ref: IN-DA002CE7

6-Nitrobenzo[b]thiophene-2-carboxylic acid

CAS: 19983-42-7

6-Nitrobenzo[b]thiophene-2-carboxylic acid

Purity: 95%

Molecular weight: 223.21g/mol

Ref: 54-OR183517

6-Nitrobenzo[b]thiophene-2-carboxylic acid

CAS: 19983-42-7

Formula: C₉H₅NO₄S

Purity: 95.0%

Molecular weight: 223.2

Ref: 10-F221551