CAS 199850-67-4

N-[(4'-bromobiphenyl-4-yl)sulfonyl]-L-valine

Description:

N-[(4'-bromobiphenyl-4-yl)sulfonyl]-L-valine, with the CAS number 199850-67-4, is a chemical compound characterized by its unique structure that includes a sulfonyl group attached to an L-valine amino acid and a bromobiphenyl moiety. This compound typically exhibits properties associated with both organic and biological chemistry, including potential applications in pharmaceuticals or as a biochemical probe. The presence of the bromine atom in the biphenyl group can influence the compound's electronic properties and reactivity, while the sulfonyl group may enhance solubility and stability in various solvents. Additionally, the L-valine component contributes to the compound's chirality, which can be significant in biological interactions. Overall, this compound's characteristics, including its molecular weight, solubility, and reactivity, make it of interest in research and development within medicinal chemistry and related fields.

Formula: C₁₇H₁₈BrNO₄S

InChI: InChI=1S/C17H18BrNO4S/c1-11(2)16(17(20)21)19-24(22,23)15-9-5-13(6-10-15)12-3-7-14(18)8-4-12/h3-11,16,19H,1-2H3,(H,20,21)/t16-/m0/s1

InChI key: InChIKey=GJOCABIDMCKCEG-INIZCTEOSA-N

SMILES: CC(C)[C@@H](C(=O)O)NS(=O)(=O)c1ccc(cc1)c1ccc(cc1)Br

L-Valine, N-[(4'-bromo[1,1'-biphenyl]-4-yl)sulfonyl]-

CAS: 199850-67-4

Formula: C₁₇H₁₈BrNO₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 412.2981

Ref: IN-DA002CDQ

PD-166793

CAS: 199850-67-4

PD-166793

Purity: ≥98%

Molecular weight: 412.3g/mol

Ref: 54-BUP09865

PD-166793

CAS: 199850-67-4

PD-166793 is an MMP inhibitor with inhibitory effects on MMP-2, MMP-3 and MMP-13.PD-166793 improves myocardial ischemia in a rat heart failure model.

Formula: C₁₇H₁₈BrNO₄S

Purity: 99.86%

Color and Shape: Solid

Molecular weight: 412.3

Ref: TM-T20563

PD 166793

Controlled Product

CAS: 199850-67-4

Formula: C₁₇H₁₈BrNO₄S

Color and Shape: Neat

Molecular weight: 412.298

Ref: TR-P217680