CAS 1998701-21-5: D-Asparagine, N-(triphenylmethyl)-, hydrate (1:1)
Description:D-Asparagine, N-(triphenylmethyl)-, hydrate (1:1) is a chemical compound characterized by its unique structure, which includes the amino acid asparagine modified with a triphenylmethyl (trityl) group. This modification enhances its stability and solubility in organic solvents. The compound exists as a hydrate, indicating that it incorporates water molecules into its crystalline structure, which can influence its physical properties such as melting point and solubility. D-Asparagine itself is a non-essential amino acid that plays a role in protein synthesis and metabolic processes. The presence of the triphenylmethyl group provides significant steric hindrance, which can affect the compound's reactivity and interactions with other molecules. This compound is typically used in biochemical research and may have applications in pharmaceuticals or as a biochemical reagent. Its CAS number, 1998701-21-5, allows for precise identification in chemical databases and literature. Overall, the characteristics of this compound make it a valuable substance in various scientific fields.
Formula:C23H22N2O3·H2O
InChI:InChI=1S/C23H22N2O3.H2O/c24-20(22(27)28)16-21(26)25-23(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;/h1-15,20H,16,24H2,(H,25,26)(H,27,28);1H2/t20-;/m1./s1
InChI key:InChIKey=LGSZZNPDVYLXAC-VEIFNGETSA-N
SMILES:O=C(O)C(N)CC(=O)NC(C=1C=CC=CC1)(C=2C=CC=CC2)C=3C=CC=CC3.O
- Synonyms:
- D-Asparagine, N-(triphenylmethyl)-, hydrate (1:1)
(R)-2-Amino-4-oxo-4-(tritylamino)butanoic acid hydrate
Ref: IN-DA01EN3A
| Undefined size | To inquire |
(R)-2-Amino-4-oxo-4-(tritylamino)butanoic acid hydrate
Ref: 10-F516535
| 1g | To inquire | ||
| 5g | To inquire |
N-(Triphenylmethyl)-D-asparagine monohydrate
Ref: 3D-FT183099
| Undefined size | To inquire |
