CAS 199871-63-1

8-Methoxyquinoline-5-carboxylic acid

Description:

8-Methoxyquinoline-5-carboxylic acid is an organic compound characterized by its quinoline structure, which features a methoxy group and a carboxylic acid functional group. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but its solubility in water is limited. The presence of the methoxy group enhances its lipophilicity, while the carboxylic acid group contributes to its acidic properties. This compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anti-inflammatory properties. Additionally, it may serve as a ligand in coordination chemistry, forming complexes with metal ions. As with many quinoline derivatives, it may also exhibit fluorescence, making it useful in analytical applications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₉NO₃

InChI: InChI=1/C11H9NO3/c1-15-9-5-4-8(11(13)14)7-3-2-6-12-10(7)9/h2-6H,1H3,(H,13,14)

SMILES: COc1ccc(c2cccnc12)C(=O)O

5-Quinolinecarboxamide, N-(3,5-dichloro-4-pyridinyl)-8-methoxy-

CAS: 199871-63-1

Formula: C₁₆H₁₁Cl₂N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 348.1834

Ref: IN-DA002CF2

N-(3,5-Dichloro-4-pyridinyl)-8-methoxy-5-quinolinecarboxamide

Controlled Product

CAS: 199871-63-1

Formula: C₁₆H₁₁Cl₂N₃O₂

Color and Shape: Neat

Molecular weight: 348.183

Ref: TR-D436870