CAS 199875-69-9
:N-Arachidonoyldopamine
Description:
N-Arachidonoyldopamine (NADA) is a bioactive lipid that belongs to the class of endocannabinoids, which are compounds that interact with the endocannabinoid system in the body. It is a derivative of dopamine, featuring an arachidonic acid moiety, which contributes to its unique biological properties. NADA is known for its role as a cannabinoid receptor agonist, particularly at the CB1 receptor, and has been implicated in various physiological processes, including pain modulation, neuroprotection, and the regulation of mood. The compound exhibits lipophilic characteristics due to its long hydrocarbon chain, which influences its ability to cross cell membranes and interact with receptors. Additionally, NADA has been studied for its potential therapeutic applications in conditions such as neurodegenerative diseases and inflammation. Its synthesis involves the enzymatic conversion of dopamine and arachidonic acid, highlighting its significance in the interplay between neurotransmission and lipid signaling pathways. Overall, N-Arachidonoyldopamine represents an important intersection of neurobiology and pharmacology, warranting further investigation into its mechanisms and effects.
Formula:C28H41NO3
InChI:InChI=1S/C28H41NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-28(32)29-23-22-25-20-21-26(30)27(31)24-25/h6-7,9-10,12-13,15-16,20-21,24,30-31H,2-5,8,11,14,17-19,22-23H2,1H3,(H,29,32)/b7-6-,10-9-,13-12-,16-15-
InChI key:InChIKey=MVVPIAAVGAWJNQ-DOFZRALJSA-N
SMILES:C(CNC(CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC)=O)C1=CC(O)=C(O)C=C1
Synonyms:- (5Z,8Z,11Z,14Z)-N-[2-(3,4-Dihydroxyphenyl)ethyl]-5,8,11,14-eicosatetraenamide
- 5,8,11,14-Eicosatetraenamide, N-[2-(3,4-dihydroxyphenyl)ethyl]-, (5Z,8Z,11Z,14Z)-
- 5,8,11,14-Eicosatetraenamide, N-[2-(3,4-dihydroxyphenyl)ethyl]-, (all-Z)-
- AA-DA, Arachidonyl dopamine, NADA, N-[2,3-(4-Dihydroxyphenyl)ethyl]-5Z,8Z,11Z,14Z-eicosatetraenamide
- Aa-Da
- Arachidonoyl Dopamine
- Arachidonoyldopamide
- N-Arachidonoyl-3-Hydroxytyramine
- N-Arachidonoyldopamine
- N-Arachidonyldopamine
- N-[2-(3,4-Dihydroxyphenyl)Ethyl]-5Z,8Z,11Z,14Z-Eicosatetraenamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Arachidonoyldopamine
CAS:Formula:C28H41NO3Purity:≥ 98%Color and Shape:Clear, colourless to yellow viscous oilMolecular weight:439.64N-Arachidonoyl Dopamine
CAS:Formula:C28H41NO3Purity:>98.0%(HPLC)Color and Shape:Colorless to Yellow clear liquidMolecular weight:439.64Nada
CAS:Nada is a delactosed fermented dairy beverage, derived from milk sources, with live probiotic cultures as its mode of action. These cultures primarily include strains such as Lactobacillus acidophilus and Bifidobacterium bifidum, known for their ability to promote gut health by modulating the intestinal microbiota, enhancing gut barrier function, and modulating the immune response.
Formula:C28H41NO3Purity:Min. 95%Molecular weight:439.6 g/molN-Arachidonyldopamine
CAS:N-Arachidonyldopamine (NADA) is a selective and potent endogenous CB1 receptor agonist (Ki: 250 nM).N-Arachidonyldopamine is also a potent and selective TRPV1Formula:C28H41NO3Purity:97.65%Color and Shape:SolidMolecular weight:439.63




