CAS 19989-18-5: 2,2-dimethylchroman-6-amine
Description:2,2-Dimethylchroman-6-amine, with the CAS number 19989-18-5, is an organic compound that belongs to the class of chroman derivatives. This substance features a chroman core, which is a bicyclic structure composed of a benzene ring fused to a tetrahydrofuran ring. The presence of two methyl groups at the 2-position and an amino group at the 6-position contributes to its unique chemical properties. Typically, compounds of this nature exhibit moderate polarity due to the presence of the amino group, which can engage in hydrogen bonding. The compound may also display biological activity, making it of interest in medicinal chemistry. Its solubility characteristics can vary depending on the solvent, and it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper safety protocols are followed. Overall, 2,2-dimethylchroman-6-amine is a compound of interest for further research in both synthetic and applied chemistry contexts.
Formula:C11H15NO
InChI:InChI=1/C11H15NO/c1-11(2)6-5-8-7-9(12)3-4-10(8)13-11/h3-4,7H,5-6,12H2,1-2H3
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,2-Dimethyl-chroman-6-ylamine REF: 3D-UAA98918CAS: 19989-18-5 | Min. 95% | To inquire | Mon 05 May 25 |
![]() | 2,2-Dimethyl-chroman-6-ylamine REF: 10-F735991CAS: 19989-18-5 | 97% | - - - | Discontinued product |

2,2-Dimethyl-chroman-6-ylamine
Ref: 3D-UAA98918
1g | 881.00 € | ||
100mg | 410.00 € |

Ref: 10-F735991
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |