CAS 19993-26-1

N-ACETYL-D-ALA-D-ALA

Description:

N-Acetyl-D-Ala-D-Ala, with the CAS number 19993-26-1, is a dipeptide derivative that plays a significant role in biochemistry, particularly in the context of bacterial cell wall synthesis. This compound consists of two D-alanine residues linked by a peptide bond, with an acetyl group attached to the amino group of the first alanine. It is a crucial component in the biosynthesis of peptidoglycan, which is essential for maintaining the structural integrity of bacterial cell walls. The presence of the N-acetyl group enhances its stability and solubility in biological systems. N-Acetyl-D-Ala-D-Ala is often studied for its interactions with antibiotics, particularly those that target bacterial cell wall synthesis, such as vancomycin. Its structural characteristics allow it to mimic the natural substrates of enzymes involved in peptidoglycan synthesis, making it a valuable compound in antibiotic resistance research and drug development. Additionally, it is utilized in various biochemical assays and studies related to microbial physiology and antibiotic action.

Formula: C₈H₁₄N₂O₄

InChI: InChI=1/C8H14N2O4/c1-4(9-6(3)11)7(12)10-5(2)8(13)14/h4-5H,1-3H3,(H,9,11)(H,10,12)(H,13,14)/t4-,5-/m0/s1

SMILES: C[C@@H](C(=N[C@@H](C)C(=O)O)O)N=C(C)O

Synonyms:

• Acetylalanylalanine
• N-acetylalanylalanine
• N-acetyl-L-alanyl-L-alanine

N-Acetyl-D-alanyl-D-alanine

Controlled Product

CAS: 19993-26-1

Formula: C₈H₁₄N₂O₄

Color and Shape: Neat

Molecular weight: 202.21

Ref: TR-A168068