CAS 199934-16-2
:6,12,19,20,25,26-HEXAHYDRO-5,27:13,18:21,24-TRIETHENO-11,7-METHENO-7H-DIBENZO [B,N] [1,5,12,16]TETRAAZACYCLOTRICOSINE-5,13-DIIUM DITRIFLUOROACETATE
Description:
The chemical substance known as "6,12,19,20,25,26-HEXAHYDRO-5,27:13,18:21,24-TRIETHENO-11,7-METHENO-7H-DIBENZO [B,N] [1,5,12,16]TETRAAZACYCLOTRICOSINE-5,13-DIIUM DITRIFLUOROACETATE" with CAS number 199934-16-2 is a complex organic compound characterized by its intricate polycyclic structure, which includes multiple fused rings and nitrogen atoms. This compound features a unique arrangement of double bonds and saturated rings, contributing to its potential reactivity and stability. The presence of trifluoroacetate groups indicates that it may exhibit specific solubility and interaction properties in various solvents. Its molecular architecture suggests potential applications in fields such as medicinal chemistry, materials science, or as a ligand in coordination chemistry. The presence of multiple functional groups may also influence its biological activity, making it a candidate for further research in pharmacology or biochemistry. Overall, this compound exemplifies the complexity and diversity found in synthetic organic chemistry.
Formula:C38H30F6N4O4
InChI:InChI=1/C34H28N4.2C2HF3O2/c1-3-10-33-29(8-1)31-16-18-37(33)23-27-6-5-7-28(20-27)24-38-19-17-32(30-9-2-4-11-34(30)38)36-22-26-14-12-25(13-15-26)21-35-31;2*3-2(4,5)1(6)7/h1-20H,21-24H2;2*(H,6,7)/b35-31+,36-32+;;
Synonyms:- Ucl 1684
- 6,12,19,20,25,26-Hexahydro-5,27:13,18:21,24-trietheno-11,7-metheno-7H-dibenzo[b,n][1,5,12,16]tetraazacyclotricosine-5,
- 17,24-Diaza-1,9-Diazoniaheptacyclo[23.6.2.2~9,16~.2~19,22~.1~3,7~.0~10,15~.0~26,31~]Octatriaconta-1(32),3(38),4,6,9(37),10,12,14,16(36),19,21,25(33),26,28,30,34-Hexadecaene Bis(Trifluoroacetate) (Non-Preferred Name)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
UCL 1684 dibromide
CAS:<p>apamin-sensitive Ca2+-activated K+ channel (KCa2.1) blocker</p>Formula:C34H30Br2N4Purity:98%Color and Shape:SolidMolecular weight:654.45UCL 1684 Dibromide
CAS:Controlled ProductFormula:C34H30N4•2(Br)Color and Shape:NeatMolecular weight:573.16538UCL 1684
CAS:<p>UCL 1684 is a potent chemical compound that functions as an antimicrobial agent. It is derived from natural sources and has been extensively studied for its inhibitory action on various microbial activities. The mode of action of UCL 1684 involves the disruption of microbial cell membranes, leading to the cessation of essential cell processes and ultimately resulting in cell death. This compound demonstrates strong efficacy against a broad spectrum of both gram-positive and gram-negative bacteria, as well as certain fungi.</p>Formula:C34H30Br2N4Purity:Min. 95%Molecular weight:654.4 g/mol


