CAS 19995-46-1

4-nitro-1-benzothiophene-2-carboxylic acid

Description:

4-Nitro-1-benzothiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzothiophene ring fused with a carboxylic acid and a nitro group. This compound typically exhibits a yellow to orange crystalline appearance. It is known for its potential applications in organic synthesis and materials science, particularly in the development of dyes and pharmaceuticals. The presence of the nitro group contributes to its reactivity, making it a useful intermediate in various chemical reactions, including electrophilic substitutions. The carboxylic acid functional group imparts acidic properties, allowing for potential interactions in biological systems or with other chemical species. Additionally, the compound's solubility can vary depending on the solvent, influencing its utility in different applications. Overall, 4-nitro-1-benzothiophene-2-carboxylic acid is a versatile compound with significant relevance in both industrial and research settings.

Formula: C₉H₅NO₄S

InChI: InChI=1/C9H5NO4S/c11-9(12)8-4-5-6(10(13)14)2-1-3-7(5)15-8/h1-4H,(H,11,12)

SMILES: c1cc(c2cc(C(=O)O)sc2c1)N(=O)=O

Synonyms:

• 4-Nitrobenzo[B]Thiophene-2-Carboxylic Acid

4-Nitrobenzo[b]thiophene-2-carboxylic acid

CAS: 19995-46-1

Formula: C₉H₅NO₄S

Molecular weight: 223.2053

Ref: IN-DA002CHF

benzo[b]thiophene-2-carboxylic acid, 4-nitro-

CAS: 19995-46-1

Versatile small molecule scaffold

Formula: C₉H₅NO₄S

Purity: Min. 95%

Molecular weight: 223.2 g/mol

Ref: 3D-UAA99546