CAS 199986-75-9

N2,N2-Bis(2-hydroxyethyl)-9-isopropyl-N6-(4-methoxybenzyl)purine-2,6-diamine

Description:

N2,N2-Bis(2-hydroxyethyl)-9-isopropyl-N6-(4-methoxybenzyl)purine-2,6-diamine, with CAS number 199986-75-9, is a synthetic purine derivative characterized by its complex molecular structure, which includes multiple functional groups such as hydroxyethyl and methoxybenzyl moieties. This compound is primarily recognized for its potential biological activity, particularly in the context of medicinal chemistry and pharmacology. Its structure suggests that it may interact with biological targets, possibly influencing cellular processes or serving as a precursor for further chemical modifications. The presence of the isopropyl group may enhance lipophilicity, potentially affecting its bioavailability and pharmacokinetics. Additionally, the hydroxyethyl groups could contribute to solubility and stability in aqueous environments. Overall, this compound exemplifies the intricate design often employed in drug development, aiming to optimize therapeutic efficacy while minimizing side effects. Further studies would be necessary to elucidate its specific mechanisms of action and potential applications in clinical settings.

Formula: C₂₀H₂₈N₆O₃

InChI: InChI=1/C20H28N6O3/c1-14(2)26-13-22-17-18(21-12-15-4-6-16(29-3)7-5-15)23-20(24-19(17)26)25(8-10-27)9-11-28/h4-7,13-14,27-28H,8-12H2,1-3H3,(H,21,23,24)

SMILES: CC(C)n1cnc2c(NCc3ccc(cc3)OC)nc(nc12)N(CCO)CCO

Synonyms:

• Cvt-313
• 2-[N,N-Bis(2-hydroxyethyl)amino]-9-isopropyl-6-(4-methoxybenzylamino)purine
• 2,2'-({6-[(4-methoxybenzyl)amino]-9-(1-methylethyl)-9H-purin-2-yl}imino)diethanol

Ethanol, 2,2'-[[6-[[(4-methoxyphenyl)methyl]amino]-9-(1-methylethyl)-9H-purin-2-yl]imino]bis-

CAS: 199986-75-9

Formula: C₂₀H₂₈N₆O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 400.4747

Ref: IN-DA002CHT

CVT-313

CAS: 199986-75-9

CVT-313

Purity: ≥95%

Molecular weight: 400.47g/mol

Ref: 54-BUP03707

CVT-313

CAS: 199986-75-9

CVT-313 (NG-26) is a potent, selective, reversible, and ATP-competitive inhibitor.

Formula: C₂₀H₂₈N₆O₃

Purity: 97.46% - 97.97%

Color and Shape: Solid

Molecular weight: 400.47

Ref: TM-T3195

CVT-313

CAS: 199986-75-9

Purity: 98%

Molecular weight: 400.222

Ref: 10-F862153

CVT 313

Controlled Product

CAS: 199986-75-9

Formula: C₂₀H₂₈N₆O₃

Color and Shape: Neat

Molecular weight: 400.475

Ref: TR-C856005