CAS 20000-80-0
:2-(3,5-dimethyl-1H-pyrazol-1-yl)ethanol
Description:
2-(3,5-Dimethyl-1H-pyrazol-1-yl)ethanol is an organic compound characterized by its pyrazole ring structure, which contributes to its unique chemical properties. The presence of the hydroxyl (-OH) group in the ethanol moiety enhances its solubility in polar solvents, making it a versatile compound in various chemical applications. This substance typically exhibits moderate to high stability under standard conditions, although it may be sensitive to strong acids or bases. Its molecular structure suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Additionally, the dimethyl substitutions on the pyrazole ring can affect its biological activity, potentially making it of interest in pharmaceutical research. The compound's CAS number, 20000-80-0, allows for easy identification in chemical databases and literature. Overall, 2-(3,5-dimethyl-1H-pyrazol-1-yl)ethanol is a notable compound in organic chemistry, with implications for both synthetic and medicinal chemistry.
Formula:C7H12N2O
InChI:InChI=1/C7H12N2O/c1-6-5-7(2)9(8-6)3-4-10/h5,10H,3-4H2,1-2H3
SMILES:Cc1cc(C)n(CCO)n1
Synonyms:- 1-(b-Hydroxyethyl)-3,5-dimethylpyrazole
- 1H-pyrazole-1-ethanol, 3,5-dimethyl-
- 2-(3,5-Dimethyl-1H-pyrazol-1-yl)ethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Dimethyl-1-(2-hydroxyethyl)pyrazole
CAS:Formula:C7H12N2OPurity:95%Color and Shape:SolidMolecular weight:140.18302-(3,5-Dimethyl-1H-pyrazol-1-yl)ethan-1-ol
CAS:2-(3,5-Dimethyl-1H-pyrazol-1-yl)ethan-1-olPurity:95%Molecular weight:140.18g/mol2-(3,5-Dimethyl-1H-pyrazol-1-yl)ethanol
CAS:Formula:C7H12N2OPurity:95%Color and Shape:SolidMolecular weight:140.1862-(3,5-Dimethyl-1H-pyrazol-1-yl)-1-ethanol
CAS:2-(3,5-Dimethyl-1H-pyrazol-1-yl)-1-ethanol is an organic compound that contains both nitrogen and sulfur atoms. The synthesis of this compound is based on the rationalized method for the preparation of supramolecular compounds. This technique is a way of using intramolecular hydrogen bonding to form a covalent bond between two separate molecules. The hydroxyl group and dithiolate are ligands that bind to metal ions, forming ionic form. Due to the nmr spectra, it is likely that 2-(3,5-Dimethyl-1H-pyrazol-1-yl)-1-ethanol has a fluorescent state in which the pyrazoles are excited by light with a wavelength of 330 nm or less. The pyrazole ring can be seen in the structure below:Formula:C7H12N2OPurity:Min. 95%Molecular weight:140.18 g/mol



