CAS 20007-85-6
:(3'R)-3'-(3-hydroxyphenyl)-4-methylspiro[1,4-benzodiazepine-3,2'-oxirane]-2,5(1H,4H)-dione
Description:
The chemical substance known as (3'R)-3'-(3-hydroxyphenyl)-4-methylspiro[1,4-benzodiazepine-3,2'-oxirane]-2,5(1H,4H)-dione, with the CAS number 20007-85-6, is a complex organic compound characterized by its unique spirocyclic structure that incorporates both benzodiazepine and oxirane moieties. This compound features a 3-hydroxyphenyl group and a methyl substituent, contributing to its potential biological activity. The presence of the dione functional groups indicates that it may exhibit reactivity typical of diketones, which can participate in various chemical reactions, including nucleophilic additions. The stereochemistry at the 3' position is specified as R, suggesting a particular spatial arrangement that may influence the compound's interactions with biological targets. Such compounds are often investigated for their pharmacological properties, including potential effects on the central nervous system, due to the benzodiazepine framework. Overall, this substance represents a class of compounds that may have significant implications in medicinal chemistry and drug development.
Formula:C17H14N2O4
InChI:InChI=1/C17H14N2O4/c1-19-15(21)12-7-2-3-8-13(12)18-16(22)17(19)14(23-17)10-5-4-6-11(20)9-10/h2-9,14,20H,1H3,(H,18,22)/t14-,17?/m1/s1
SMILES:CN1C(=O)c2ccccc2N=C(C21[C@@H](c1cccc(c1)O)O2)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Cyclopenol
CAS:<p>Cyclopenol is a natural product that can be used as a reference standard. The CAS number of Cyclopenol is 20007-85-6.</p>Formula:C17H14N2O4Color and Shape:SolidMolecular weight:310.309

