CAS 2001-45-8
:Tetraphenylphosphonium chloride
Description:
Tetraphenylphosphonium chloride is an organic compound with the chemical formula (C6H5)4PCl. It is characterized by a central phosphorus atom bonded to four phenyl groups, making it a quaternary ammonium salt. This compound typically appears as a white to light yellow crystalline solid and is soluble in polar organic solvents such as acetone and ethanol, but is generally insoluble in water. Tetraphenylphosphonium chloride is known for its role as a phase transfer catalyst in organic synthesis, facilitating the transfer of ions across phase boundaries. Additionally, it can be used in the preparation of other phosphonium salts and as a reagent in various chemical reactions. The compound exhibits stability under normal conditions but should be handled with care due to its potential toxicity and irritant properties. Its applications extend to fields such as organic chemistry, materials science, and biochemistry, where it aids in the synthesis of complex molecules and the study of ionic interactions.
Formula:C24H20ClP
InChI:InChI=1/C24H20P.ClH/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h1-20H;1H/q+1;
InChI key:InChIKey=WAGFXJQAIZNSEQ-UHFFFAOYSA-M
SMILES:[P+](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]
Synonyms:- Chlorotetraphenylphosphorane
- Phosphonium, Tetraphenyl-, Hydrochloride
- Phosphonium, tetraphenyl-, chloride
- Phosphonium, tetraphenyl-, chloride (1:1)
- T 1735
- Tetra Phenyl Phosphonium Chloride
- Tetraphenyl phosphonium chloride
- Tetraphenylchlorophosphine
- Tetraphenylphosphanium chloride
- Tetraphenylphosponium Chloride
- Tetraphenylphosphonium chloride
- tetraphenylphosphonium chloride
- TETRAPHENYLPHOSPHONIUM CHLORID
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Tetraphenylphosphonium Chloride
CAS:Formula:C24H20ClPPurity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:374.85Tetraphenylphosphonium chloride, 98%
CAS:Tetraphenylphosphonium chloride is used to generate lipophilic salts from inorganic and organometallic anions. Thus, Ph4P+ is useful as a phase-transfer catalyst, again because it allows inorganic anions to dissolve in organic solvents. This Thermo Scientific Chemicals brand product was originally pFormula:C24H20ClPPurity:98%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:374.85Phosphonium, tetraphenyl-, chloride (1:1)
CAS:Formula:C24H20ClPPurity:97%Color and Shape:SolidMolecular weight:374.8424Ref: IN-DA002CJH
5g25.00€2g27.00€10g28.00€25g31.00€50g49.00€75g57.00€100g69.00€200g106.00€300g124.00€500g150.00€1kg193.00€2.5kg640.00€Tetraphenylphosphonium chloride
CAS:Tetraphenylphosphonium chlorideFormula:C24H20ClPPurity:≥95%Color and Shape:Solid-CrystalMolecular weight:374.84Tetraphenylphosphonium Chloride
CAS:Tetraphenylphosphonium ChlorideFormula:C24H20ClPPurity:98%Color and Shape:Solid-CrystalsMolecular weight:374.84Tetraphenylphosphonium chloride
CAS:Tetraphenylphosphonium chlorideFormula:C24H20ClPPurity:97%Molecular weight:374.84Tetraphenylphosphonium chloride
CAS:Formula:C24H20ClPPurity:95%Color and Shape:Solid, CrystallineMolecular weight:374.85





