CAS 2001-95-8: Valinomycin
Description:Valinomycin is a cyclic ionophore antibiotic that is primarily known for its ability to selectively transport potassium ions across lipid membranes. It is composed of a 12-membered lactone ring formed by the condensation of several amino acids, including valine, which gives it its name. Valinomycin exhibits a high affinity for K+ ions due to its unique structure, which allows it to encapsulate the ion effectively, facilitating its movement through biological membranes. This property makes valinomycin a valuable tool in biochemical research, particularly in studies involving ion transport and membrane potential. Additionally, valinomycin has been shown to exhibit antimicrobial activity against various microorganisms. Its mechanism of action involves disrupting the ionic balance within cells, leading to cell death. Valinomycin is soluble in organic solvents and has limited solubility in water, which influences its application in laboratory settings. Due to its potent biological effects, it is used in various experimental protocols, including studies on ion channels and cellular signaling pathways.
Formula:C54H90N6O18
InChI:InChI=1/C54H90N6O18/c1-22(2)34-49(67)73-31(19)43(61)55-38(26(9)10)53(71)77-41(29(15)16)47(65)59-36(24(5)6)51(69)75-33(21)45(63)57-39(27(11)12)54(72)78-42(30(17)18)48(66)60-35(23(3)4)50(68)74-32(20)44(62)56-37(25(7)8)52(70)76-40(28(13)14)46(64)58-34/h22-42H,1-21H3,(H,55,61)(H,56,62)(H,57,63)(H,58,64)(H,59,65)(H,60,66)/t31-,32-,33-,34+,35+,36?,37-,38-,39-,40+,41+,42+/m0/s1
- Synonyms:
- 1,7,13,19,25,31-Hexaoxa-4,10,16,22,28,34-hexaazacyclohexatriacontane-2,5,8,11,14,17,20,23,26,29,32,35-dodecone, 3,6,9,15,18,21,27,30,33-nonaisopropyl-12,24,36-trimethyl-
- Cyclo(D-α-hydroxyisovaleryl-D-valyl-L-lactoyl-L-valyl-D-α-hydroxyisovaleryl-D-valyl-L-lactoyl-L-valyl-D-α-hydroxyisovaleryl-D-valyl-L-lactoyl-L-valyl)
- Nsc 122023
- Valinomicin
- Valinomicina
- Valinomycine