CAS 20012-10-6

1H-3-Benzazepine-7,8-diol, 2,3,4,5-tetrahydro-1-phenyl-, hydrobromide (1:1)

Description:

1H-3-Benzazepine-7,8-diol, 2,3,4,5-tetrahydro-1-phenyl-, hydrobromide (1:1) is a chemical compound characterized by its complex bicyclic structure, which includes a benzazepine core. This compound features a hydroxyl group at the 7 and 8 positions, contributing to its potential reactivity and solubility in polar solvents. The presence of the hydrobromide salt form indicates that it is a protonated species, enhancing its stability and solubility in aqueous environments. Typically, compounds of this nature may exhibit biological activity, potentially interacting with various receptors or enzymes due to their structural features. The tetrahydro configuration suggests that it is a saturated derivative, which may influence its pharmacokinetic properties. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and usage, as with any chemical, to ensure proper precautions are taken.

Formula: C₁₆H₁₇NO₂·BrH

InChI: InChI=1S/C16H17NO2.BrH/c18-15-8-12-6-7-17-10-14(13(12)9-16(15)19)11-4-2-1-3-5-11;/h1-5,8-9,14,17-19H,6-7,10H2;1H

InChI key: InChIKey=INNWVRBZMBCEJI-UHFFFAOYSA-N

SMILES: OC=1C=C2C(CNCCC2=CC1O)C3=CC=CC=C3.Br

Synonyms:

• 1H-3-Benzazepine-7,8-diol, 2,3,4,5-tetrahydro-1-phenyl-, hydrobromide
• (±)-2,3,4,5-Tetrahydro-7,8-dihydroxy-1-phenyl-1H-3-benzazepine monohydrobromide
• 1H-3-Benzazepine-7,8-diol, 2,3,4,5-tetrahydro-1-phenyl-, hydrobromide (1:1)

SKF 38393 hydrobromide - Bio-X

CAS: 20012-10-6

Formula: C₁₆H₁₈BrNO₂

Purity: 98%

Molecular weight: 336.2236

Ref: IN-DA01EG23

SKF38393 hydrobromide

CAS: 20012-10-6

SKF38393 hydrobromide is the salt form of SKF38393.a dopamine D1 receptor agonist that increases the expression of Shati/Nat8L mRNA in the NAc of mice;

Formula: C₁₆H₁₈BrNO₂

Purity: 98.99%

Color and Shape: Solid

Molecular weight: 336.22

Ref: TM-T23359

SKF 38393 hydrobromide

CAS: 20012-10-6

Dopamine (D1) receptor agonist

Formula: C₁₆H₁₇NO₂·HBr

Purity: Min. 95%

Molecular weight: 336.22 g/mol

Ref: 3D-FP157163