CAS 200126-82-5

N-(4-Carbethoxyphenyl)maleamic acid

Description:

N-(4-Carbethoxyphenyl)maleamic acid is an organic compound characterized by its unique structure, which includes a maleamic acid moiety and a carbethoxyphenyl group. This compound typically exhibits properties associated with both amines and carboxylic acids, making it a versatile intermediate in organic synthesis. It is likely to be a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the carboxylic acid functional group. The compound may participate in various chemical reactions, including amide formation and cyclization, owing to its functional groups. Additionally, it may exhibit biological activity, which can be explored for pharmaceutical applications. Its molecular structure suggests potential for hydrogen bonding, influencing its physical properties such as melting point and solubility. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use. Overall, N-(4-Carbethoxyphenyl)maleamic acid represents a valuable compound in the field of organic chemistry and materials science.

Formula: C₁₃H₁₃NO₅

InChI: InChI=1/C13H13NO5/c1-2-19-13(18)9-3-5-10(6-4-9)14-11(15)7-8-12(16)17/h3-8H,2H2,1H3,(H,14,15)(H,16,17)/b8-7-

SMILES: CCOC(=O)c1ccc(cc1)NC(=O)/C=C\C(=O)O

Synonyms:

• N-(4-ethoxycarbonylphenyl)maleamic acid
• (2Z)-4-{[4-(ethoxycarbonyl)phenyl]amino}-4-oxobut-2-enoate
• (2Z)-4-{[4-(ethoxycarbonyl)phenyl]amino}-4-oxobut-2-enoic acid

N-(4-Ethoxycarbonylphenyl)maleamic acid

CAS: 200126-82-5

Formula: C₁₃H₁₃NO₅

Molecular weight: 263.2460

Ref: IN-DA002CJP

4-{[4-(Ethoxycarbonyl)phenyl]amino}-4-oxobut-2-enoic acid

CAS: 200126-82-5

4-{[4-(Ethoxycarbonyl)phenyl]amino}-4-oxobut-2-enoic acid

Purity: ≥95%

Molecular weight: 263.25g/mol

Ref: 54-OR110035