CAS 20014-08-8
:1-[(4-ethoxyphenyl)amino]-3-(propan-2-ylamino)propan-2-ol dihydrochloride
Description:
1-[(4-ethoxyphenyl)amino]-3-(propan-2-ylamino)propan-2-ol dihydrochloride, with the CAS number 20014-08-8, is a chemical compound that belongs to the class of amino alcohols. It features a complex structure characterized by the presence of an ethoxyphenyl group and two amino groups, which contribute to its potential biological activity. The dihydrochloride form indicates that the compound is a salt, enhancing its solubility in water, which is often beneficial for pharmacological applications. This compound may exhibit properties such as being a potential therapeutic agent, possibly influencing neurotransmitter systems or other biological pathways due to its amino alcohol structure. Its molecular interactions can be influenced by the presence of the ethoxy group, which may affect lipophilicity and bioavailability. As with many organic compounds, its stability, reactivity, and specific applications would depend on the conditions under which it is used, including pH, temperature, and the presence of other substances. Further research would be necessary to fully elucidate its pharmacological properties and potential uses.
Formula:C14H26Cl2N2O2
InChI:InChI=1/C14H24N2O2.2ClH/c1-4-18-14-7-5-12(6-8-14)16-10-13(17)9-15-11(2)3;;/h5-8,11,13,15-17H,4,9-10H2,1-3H3;2*1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propanol, 1-[(4-ethoxyphenyl)amino]-3-[(1-methylethyl)amino]-, hydrochloride (1:2)
CAS:Formula:C14H26Cl2N2O2Molecular weight:325.2744
