CAS 2002-03-1
:5-phenyl-1,3,4-thiadiazol-2-amine
Description:
5-Phenyl-1,3,4-thiadiazol-2-amine is a heterocyclic compound characterized by the presence of a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom within a five-membered ring structure. This compound features a phenyl group attached to the thiadiazole, contributing to its aromatic properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the amino group (-NH2) enhances its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. This compound is of interest in medicinal chemistry and materials science due to its potential biological activities and applications in the development of pharmaceuticals and agrochemicals. Additionally, its unique structural features may impart specific electronic and optical properties, making it suitable for research in organic electronics and dye-sensitized solar cells. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H9N3O4S2
InChI:InChI=1/C8H7N3S.H2O4S/c9-8-11-10-7(12-8)6-4-2-1-3-5-6;1-5(2,3)4/h1-5H,(H2,9,11);(H2,1,2,3,4)
SMILES:c1ccc(cc1)c1n[nH]c(=N)s1.OS(=O)(=O)O
Synonyms:- 1,3,4-Thiadiazol-2-amine, 5-phenyl-
- 5-Phenyl-1,3,4-thiadiazol-2-amin
- 5-Phenyl-1,3,4-Thiadiazol-2-Amine Sulfate
- 5-Phenyl-1,3,4-thiadiazol-2-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-5-phenyl-1,3,4-thiadiazol
CAS:Formula:C8H7N3SPurity:>98.0%(T)(HPLC)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:177.232-Amino-5-phenyl-1,3,4-thiadiazole, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H7N3SPurity:97%Color and Shape:White, PowderMolecular weight:177.231,3,4-Thiadiazol-2-amine, 5-phenyl-
CAS:Formula:C8H7N3SPurity:96%Color and Shape:SolidMolecular weight:177.22632-Amino-5-phenyl-1,3,4-thiadiazole
CAS:2-Amino-5-phenyl-1,3,4-thiadiazolePurity:95Molecular weight:177.23g/mol5-Phenyl-1,3,4-thiadiazole-2-yl-amine
CAS:Formula:C8H7N3SPurity:96%Color and Shape:Solid, White crystalline powderMolecular weight:177.23




