CAS 20021-12-9
:2-(2,4-dichloro-6-methylphenoxy)propanoic acid
Description:
2-(2,4-Dichloro-6-methylphenoxy)propanoic acid, commonly known as dicamba, is a selective herbicide used primarily for controlling broadleaf weeds in various crops. It belongs to the class of benzoic acid derivatives and features a phenoxy group, which contributes to its herbicidal activity. The compound is characterized by its relatively low solubility in water but is more soluble in organic solvents, which aids in its application. Dicamba acts by mimicking natural plant hormones, leading to uncontrolled growth and eventual plant death in susceptible species. It is typically applied post-emergence and is known for its systemic properties, allowing it to be absorbed and translocated within the plant. While effective, dicamba has been associated with off-target movement and potential environmental concerns, prompting regulatory scrutiny and the development of formulations designed to minimize drift. Its chemical structure includes two chlorine atoms and a methyl group, which influence its herbicidal efficacy and environmental behavior. Proper handling and application are essential to mitigate risks associated with its use.
Formula:C10H10Cl2O3
InChI:InChI=1/C10H10Cl2O3/c1-5-3-7(11)4-8(12)9(5)15-6(2)10(13)14/h3-4,6H,1-2H3,(H,13,14)
SMILES:Cc1cc(cc(c1OC(C)C(=O)O)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(4,6-Dichloro-2-methylphenoxy)propionic acid
CAS:Formula:C10H10Cl2O3Color and Shape:NeatMolecular weight:249.09

