CAS 20028-40-4

(1-Methyl-1H-benzimidazol-2-yl)methylamine

Description:

(1-Methyl-1H-benzimidazol-2-yl)methylamine, with the CAS number 20028-40-4, is an organic compound characterized by its benzimidazole structure, which consists of a fused benzene and imidazole ring. This compound features a methyl group attached to the nitrogen of the imidazole ring and a methylamine group, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents, reflecting its potential for various applications in pharmaceuticals and biochemistry. The presence of both the benzimidazole and amine functionalities suggests that it may exhibit biological activity, possibly interacting with biological targets such as enzymes or receptors. Its molecular structure allows for potential hydrogen bonding and interactions with other molecules, which can influence its reactivity and stability. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₉H₁₂N₃

InChI: InChI=1/C9H11N3/c1-12-8-5-3-2-4-7(8)11-9(12)6-10/h2-5H,6,10H2,1H3/p+1

Synonyms:

• 1-(1-methyl-1H-benzimidazol-2-yl)methanamine
• (1-methyl-1H-benzimidazol-2-yl)methanaminium

1H-Benzimidazole-2-methanamine, 1-methyl-

CAS: 20028-40-4

Formula: C₉H₁₁N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 161.2037

Ref: IN-DA002CNE

2-(Aminomethyl)-1-methyl-1H-benzimidazole

CAS: 20028-40-4

2-(Aminomethyl)-1-methyl-1H-benzimidazole

Formula: C₉H₁₁N₃

Purity: 95%

Color and Shape: pale brown crystalline solid

Molecular weight: 161.20g/mol

Ref: 54-OR12313

C-(1-Methyl-1 H -benzoimidazol-2-yl)-methylamine

CAS: 20028-40-4

Formula: C₉H₁₁N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 161.208

Ref: 10-F031009

(1-Methyl-1H-benzimidazol-2-yl)methylamine

Controlled Product

CAS: 20028-40-4

(1-Methyl-1H-benzimidazol-2-yl)methylamine is a heterocyclic compound with the chemical formula C6H5NCH3. It is used in organic synthesis as a building block for other compounds. (1-Methyl-1H-benzimidazol-2-yl)methylamine can be synthesized by reacting methylamine and benzimidazole in solvothermal conditions, followed by purification with ionization mass spectrometry. The compound has a molecular weight of 136 g/mol and an ionization mass of 133. This compound is homolytic under standard conditions, meaning that it undergoes reaction processes that break covalent bonds using heat or light energy. This process creates ions from neutral molecules, which are then analyzed by ionization mass spectrometry to determine the composition of the molecule.

Formula: C₉H₁₁N₃

Purity: Min. 95%

Color and Shape: Slightly Yellow Powder

Molecular weight: 161.2 g/mol

Ref: 3D-FM50759