CAS 2004-06-0: 6-Chloro-9-ribofuranosyl-9H-purine
Description:6-Chloro-9-ribofuranosyl-9H-purine, commonly known as cladribine, is a synthetic purine nucleoside analog that exhibits significant biological activity. It features a ribofuranosyl sugar moiety attached to a purine base, specifically 9H-purine, with a chlorine substituent at the 6-position. This compound is primarily recognized for its role as an immunosuppressive agent, particularly in the treatment of certain hematological malignancies and autoimmune diseases. Cladribine is known to interfere with DNA synthesis and repair, leading to the selective depletion of lymphocytes, which is beneficial in conditions like multiple sclerosis. The compound is typically administered intravenously or orally, and its pharmacokinetics involve rapid distribution and metabolism. Its therapeutic efficacy is accompanied by potential side effects, including immunosuppression and increased risk of infections. Overall, 6-Chloro-9-ribofuranosyl-9H-purine is a crucial compound in modern medicine, particularly in oncology and immunology.
Formula:C10H11ClN4O4
InChI:InChI=1/C10H11ClN4O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2/t4-,6-,7-,10?/s2
InChI key:InChIKey=XHRJGHCQQPETRH-HRBNIKIZNA-N
SMILES:ClC1=NC=NC2=C1N=CN2C3OC(CO)C(O)C3O
- Synonyms:
- 6-Chloro-9-ribofuranosyl-9H-purine
- 6-Chloropurine nucleoside
- 6-Chloropurine ribonucleoside
- 6-Chloropurine ribose
- 6-Chloropurine-9-¤-D-ribofuranoside
- 6-chloro-9-(beta-D-ribofuranosyl)-9H-purine
- 6-chloro-9-alpha-L-lyxofuranosyl-9H-purine
- 6-chloro-9-pentofuranosyl-9H-purine
- 9H-Purine, 6-chloro-9-ribofuranosyl-

6-Chloropurine Riboside
Ref: 3B-C2206
1g | 58.00 € | ||
5g | 185.00 € |

6-Chloropurine riboside, 98%
Ref: 02-J64612
50g | To inquire |

9H-Purine, 6-chloro-9-ribofuranosyl-
Ref: IN-DA002CQY
1g | 25.00 € | ||
5g | 51.00 € | ||
10g | 63.00 € | ||
25g | 115.00 € | ||
100g | 270.00 € |

6-Chloropurine riboside
Ref: 54-OR303362
5g | 41.00 € | ||
25g | 96.00 € |

Ref: SR-57430
1g | 102.00 € | ||
250mg | 40.00 € |