CAS 200416-89-3
:N-(4-phenylbutan-2-yl)3-oxobutanamide
Description:
N-(4-phenylbutan-2-yl)3-oxobutanamide, with the CAS number 200416-89-3, is an organic compound characterized by its amide functional group and a ketone moiety. This substance features a butanamide backbone, which is substituted with a phenyl group and a branched alkyl chain, contributing to its unique structural properties. The presence of the ketone group indicates potential reactivity, particularly in nucleophilic addition reactions. The compound's molecular structure suggests it may exhibit specific biological activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the compound's physical properties, such as melting point and boiling point, would be influenced by its molecular weight and intermolecular interactions. As with many organic compounds, safety and handling precautions are essential, particularly regarding potential toxicity or reactivity with other substances. Overall, N-(4-phenylbutan-2-yl)3-oxobutanamide represents a complex molecule with potential applications in various chemical and pharmaceutical contexts.
Formula:C14H19NO2
InChI:InChI=1S/C14H19NO2/c1-11(15-14(17)10-12(2)16)8-9-13-6-4-3-5-7-13/h3-7,11H,8-10H2,1-2H3,(H,15,17)
SMILES:CC(CCc1ccccc1)N=C(CC(=O)C)O
Synonyms:- 3-oxo-N-(4-phenylbutan-2-yl)butanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
