
CAS 20045-34-5
:1,2,3-Benzenetriol, potassium salt (1:?)
Description:
1,2,3-Benzenetriol, potassium salt (CAS 20045-34-5) is a chemical compound that features a benzene ring with three hydroxyl (-OH) groups positioned at the 1, 2, and 3 carbon atoms, making it a triol. The presence of the potassium salt indicates that the hydroxyl groups are likely deprotonated, forming a potassium salt, which enhances its solubility in water compared to its neutral form. This compound is typically characterized by its potential applications in various fields, including pharmaceuticals and biochemistry, due to its antioxidant properties and ability to participate in redox reactions. The potassium salt form may also influence its stability and reactivity, making it useful in formulations where ionic strength and solubility are critical. Additionally, 1,2,3-benzenetriol derivatives can exhibit biological activity, which may be of interest in medicinal chemistry. Overall, this compound represents a versatile chemical with significant implications in both industrial and research settings.
Formula:C6H6O3·xK
InChI:InChI=1S/C6H6O3.K/c7-4-2-1-3-5(8)6(4)9;/h1-3,7-9H;
InChI key:InChIKey=KBQYYUYZBWCSJK-UHFFFAOYSA-N
SMILES:OC1=C(O)C=CC=C1O.[K]
Synonyms:- 1,2,3-Benzenetriol, potassium salt
- 1,2,3-Benzenetriol, potassium salt (1:?)
- Pyrogallol, potassium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
