
CAS 2004659-85-0
:N-Methyl-4-phenoxy-2-pyridinecarboxamide
Description:
N-Methyl-4-phenoxy-2-pyridinecarboxamide is a chemical compound characterized by its unique structural features, which include a pyridine ring, a carboxamide functional group, and a phenoxy substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the N-methyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Additionally, the phenoxy group can impart specific interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting various biological pathways. Its CAS number, 2004659-85-0, allows for precise identification and retrieval of information regarding its synthesis, properties, and safety data. As with many chemical substances, understanding its characteristics is crucial for evaluating its potential uses and implications in research and industry.
Formula:C13H12N2O2
InChI:InChI=1S/C13H12N2O2/c1-14-13(16)12-9-11(7-8-15-12)17-10-5-3-2-4-6-10/h2-9H,1H3,(H,14,16)
InChI key:InChIKey=DIRHRENMOVLIJC-UHFFFAOYSA-N
SMILES:O(C=1C=C(C(NC)=O)N=CC1)C2=CC=CC=C2
Synonyms:- 2-Pyridinecarboxamide, N-methyl-4-phenoxy-
- N-Methyl-4-phenoxy-2-pyridinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Sorafenib Impurity 21
CAS:Formula:C13H12N2O2Color and Shape:White To Off-White SolidMolecular weight:228.25

