CAS 2005-43-8
:2-Bromoquinoline
Description:
2-Bromoquinoline is a chemical compound that belongs to the class of heterocyclic aromatic compounds, specifically a brominated derivative of quinoline. It features a bromine atom substituted at the second position of the quinoline ring, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. This compound is typically characterized by its pale yellow to brownish appearance and has a distinct aromatic odor. It is sparingly soluble in water but more soluble in organic solvents such as ethanol and dichloromethane. 2-Bromoquinoline is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in the synthesis of pharmaceuticals and agrochemicals. The presence of the bromine atom can enhance its reactivity, making it a useful intermediate in organic synthesis. Additionally, it may exhibit biological activity, which warrants further investigation into its pharmacological properties. As with many brominated compounds, safety precautions should be taken when handling 2-bromoquinoline due to potential toxicity and environmental concerns.
Formula:C9H6BrN
InChI:InChI=1/C9H6BrN/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H
SMILES:c1ccc2c(c1)ccc(Br)n2
Synonyms:- Quinoline, 2-bromo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Bromoquinoline
CAS:Formula:C9H6BrNPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:208.062-Bromoquinoline, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H6BrNPurity:96%Color and Shape:White to yellow to red, Crystals or powder or crystalline powderMolecular weight:208.06Ref: IN-DA002CTM
1g25.00€5g47.00€10g63.00€1kgTo inquire25g97.00€100g217.00€500gTo inquire250mgTo inquire2-Bromoquinoline
CAS:2-BromoquinolineFormula:C9H6BrNPurity:97%Color and Shape: faint brown solidMolecular weight:208.05463g/mol2-Bromoquinoline
CAS:<p>2-Bromoquinoline is an antimicrobial agent that binds to bacterial receptors. It is a bifunctional molecule with two reactive groups: a hydroxyl group and a nitrogen atom. 2-Bromoquinoline has been shown to inhibit the growth of various bacteria, including Mycobacterium tuberculosis, Staphylococcus epidermidis and Streptococcus pyogenes, by preventing the formation of a proton gradient across the bacterial membrane. 2-Bromoquinoline also inhibits hyperproliferative diseases such as amyloidosis in mice by binding to amyloid fibrils. This drug has been shown to cause DNA damage in mammalian cells, which may be due to its ability to form hydrogen bonds with methyl ethyl groups on DNA bases.</p>Formula:C9H6BrNPurity:Min. 95%Color and Shape:White To Yellow To Pink SolidMolecular weight:208.05 g/mol






