CAS 20053-88-7

Hotrienol

Description:

Hotrienol, with the CAS number 20053-88-7, is a chemical compound classified as a terpenoid alcohol. It is primarily known for its role as a fragrance and flavoring agent, often found in various essential oils. Hotrienol has a distinctive floral and fruity aroma, making it valuable in the perfume and cosmetic industries. The compound is characterized by its relatively low molecular weight and specific structural features typical of terpenoids, which contribute to its volatility and olfactory properties. In terms of solubility, Hotrienol is generally soluble in organic solvents but has limited solubility in water. Its stability can be influenced by environmental factors such as light and temperature, which may lead to degradation over time. Additionally, Hotrienol is of interest in research for its potential biological activities, although further studies are needed to fully understand its effects and applications. Overall, Hotrienol is a versatile compound with significant utility in various industrial applications, particularly in the fragrance sector.

Formula: C₁₀H₁₆O

InChI: InChI=1S/C10H16O/c1-5-10(4,11)8-6-7-9(2)3/h5-7,11H,1-2,8H2,3-4H3/b7-6+/t10-/m0/s1

InChI key: InChIKey=ZJIQIJIQBTVTDY-FGEFZZPRSA-N

SMILES: [C@@](C/C=C/C(C)=C)(C=C)(C)O

Synonyms:

• (-)-trans-Khotrienol
• (3R,5E)-3,7-Dimethyl-1,5,7-octatrien-3-ol
• (5E)-3,5-dimethylocta-1,5,7-trien-3-ol
• (5E)-3,7-Dimethylocta-1,5,7-trien-3-ol
• 1,5,7-Octatrien-3-ol, 3,7-dimethyl-, (3R,5E)-
• 1,5,7-Octatrien-3-ol, 3,7-dimethyl-, (E)-(R)-(-)-
• 1,5,7-Octatrien-3-ol, 3,7-dimethyl-, [R-(E)]-
• Hotrienol, trans-(-)-
• trans-(-)-Hotrienol

3,7-Dimethyl-1,5,7-octatrien-3-ol (Hotrienol)

CAS: 20053-88-7

Formula: C₁₀H₁₆O

Purity: 95%

Molecular weight: 152.2334

Ref: IN-DA002CU9

Hotrienol

CAS: 20053-88-7

Hotrienol is a sesquiterpene alcohol, which is a naturally occurring organic compound. It is primarily sourced from certain essential oils, such as those derived from Cypress species and various aromatic plants. These oils are obtained through steam distillation or cold pressing methods, allowing for the extraction of volatile compounds where Hotrienol is present.

Formula: C₁₀H₁₆O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 152.23 g/mol

Ref: 3D-XH173392