CAS 20057-16-3
:5-methyl-5,10-dihydrophenazine
Description:
5-Methyl-5,10-dihydrophenazine is an organic compound characterized by its phenazine backbone, which is a bicyclic structure composed of two fused aromatic rings. This compound features a methyl group at the 5-position and two hydrogen atoms at the 5 and 10 positions, contributing to its dihydro status. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific form. The presence of the methyl group can influence its solubility and reactivity, making it more hydrophobic compared to its non-methylated counterparts. 5-Methyl-5,10-dihydrophenazine may have applications in organic synthesis, materials science, and potentially in biological systems due to its structural similarity to other biologically relevant compounds. Its chemical properties, such as stability, reactivity, and interaction with other substances, can vary based on environmental conditions like pH and temperature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C13H12N2
InChI:InChI=1/C13H12N2/c1-15-12-8-4-2-6-10(12)14-11-7-3-5-9-13(11)15/h2-9,14H,1H3
SMILES:Cn1c2ccccc2[nH]c2ccccc12
Synonyms:- Phenazine, 5,10-Dihydro-5-Methyl-
- 5-Methyl-5,10-dihydrophenazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5,10-dihydro-5-methyl-Phenazine
CAS:Controlled Product<p>Applications 5,10-dihydro-5-methyl-Phenazine is a compound used frequently in electron-transfer reaction analyses.<br>References Ghosh, M.; et al.: Inorg. Chim. Act.. 225, 297 (1994). Carloni, P.; et al.: Research on Chemical Intermediates, 19, 643 (1993).<br></p>Formula:C13H12N2Color and Shape:NeatMolecular weight:196.248

