CAS 200575-16-2

5-(Chlorosulfonyl)-2-ethoxybenzoic acid

Description:

5-(Chlorosulfonyl)-2-ethoxybenzoic acid is an organic compound characterized by its sulfonyl chloride functional group, which imparts significant reactivity, particularly in nucleophilic substitution reactions. This compound features a benzoic acid moiety, indicating it possesses both acidic and aromatic characteristics. The presence of the ethoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The chlorosulfonyl group is known for its ability to act as a strong electrophile, making this compound useful in various synthetic applications, including the preparation of sulfonamide derivatives. Additionally, the compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where modifications of the benzoic acid framework can lead to biologically active molecules. Its CAS number, 200575-16-2, allows for precise identification in chemical databases, facilitating research and development efforts. As with many sulfonyl compounds, handling precautions are advised due to potential reactivity and toxicity.

Formula: C₉H₉ClO₅S

InChI: InChI=1S/C9H9ClO5S/c1-2-15-8-4-3-6(16(10,13)14)5-7(8)9(11)12/h3-5H,2H2,1H3,(H,11,12)

InChI key: InChIKey=UHNRCKXZRULNSC-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(OCC)C=CC(S(Cl)(=O)=O)=C1

Synonyms:

• 5-Chlorosulfonyl-2-Ethoxybenzoic Acid
• 5-Chlorosulfonyl-2-ethoxybenzoicacid
• Benzoic acid, 5-(chlorosulfonyl)-2-ethoxy-

Benzoic acid, 5-(chlorosulfonyl)-2-ethoxy-

CAS: 200575-16-2

Formula: C₉H₉ClO₅S

Purity: 98%

Color and Shape: Solid

Molecular weight: 264.6828

Ref: IN-DA002CUF

5-(Chlorosulfonyl)-2-ethoxybenzoic acid

CAS: 200575-16-2

5-(Chlorosulfonyl)-2-ethoxybenzoic acid

Purity: 98%

Molecular weight: 264.68g/mol

Ref: 54-OR93743

5-(Chlorosulfonyl)-2-ethoxybenzoic acid

CAS: 200575-16-2

Formula: C₉H₉ClO₅S

Purity: 98%

Molecular weight: 264.68

Ref: 10-F226688

5-(Chlorosulfonyl)-2-ethoxybenzoic acid

CAS: 200575-16-2

5-(Chlorosulfonyl)-2-ethoxybenzoic acid is a synthetic drug that inhibits the enzyme phosphodiesterase type 5 (PDE5), which is responsible for degradation of cyclic guanosine monophosphate (cGMP). It has been shown to be effective in the treatment of erectile dysfunction, with improved efficacy and reduced side effects when compared to sildenafil. 5-(Chlorosulfonyl)-2-ethoxybenzoic acid belongs to a class of drugs called phosphodiesterase inhibitors. Studies have found that it increases the duration and quality of erections by inhibiting PDE5, an enzyme that breaks down cGMP. This inhibition leads to an increase in cGMP levels, which relaxes smooth muscle cells in the corpus cavernosum and causes increased blood flow into the penis.

Formula: C₉H₉ClO₅S

Purity: Min. 95%

Molecular weight: 264.68 g/mol

Ref: 3D-AIA57516