CAS 2006277-02-5

3-(Cyclopropylmethoxy)-4-ethoxybenzeneacetic acid

Description:

3-(Cyclopropylmethoxy)-4-ethoxybenzeneacetic acid, identified by its CAS number 2006277-02-5, is an organic compound characterized by its unique molecular structure, which includes a benzene ring substituted with both cyclopropylmethoxy and ethoxy groups, as well as an acetic acid moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions due to the presence of functional groups. The cyclopropyl group may impart distinctive steric and electronic effects, influencing the compound's reactivity and interactions. The ethoxy group contributes to the overall hydrophobic character, while the acetic acid component introduces acidity, allowing for potential ionization in solution. Such characteristics may make this compound of interest in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to aromatic systems can enhance biological activity or selectivity. Additionally, its solubility and stability in various solvents can be crucial for its application in research and industry.

Formula: C₁₄H₁₈O₄

InChI: InChI=1S/C14H18O4/c1-2-17-12-6-5-11(8-14(15)16)7-13(12)18-9-10-3-4-10/h5-7,10H,2-4,8-9H2,1H3,(H,15,16)

InChI key: InChIKey=CKLBIWVUCMACMJ-UHFFFAOYSA-N

SMILES: O(CC1CC1)C2=C(OCC)C=CC(CC(O)=O)=C2

Synonyms:

• Benzeneacetic acid, 3-(cyclopropylmethoxy)-4-ethoxy-
• 3-(Cyclopropylmethoxy)-4-ethoxybenzeneacetic acid

2-[3-(Cyclopropylmethoxy)-4-ethoxyphenyl]acetic acid

CAS: 2006277-02-5

2-[3-(Cyclopropylmethoxy)-4-ethoxyphenyl]acetic acid

Purity: ≥95%

Molecular weight: 250.29g/mol

Ref: 54-OR470787