CymitQuimica logo

CAS 2006286-94-6

:

1,1-Dimethylethyl (3S)-4-bromo-3-[[(1,1-dimethylethoxy)carbonyl]amino]butanoate

Description:
1,1-Dimethylethyl (3S)-4-bromo-3-[[(1,1-dimethylethoxy)carbonyl]amino]butanoate, identified by its CAS number 2006286-94-6, is a synthetic organic compound characterized by its complex structure, which includes a bromine atom and a dimethylethyl group. This compound features a butanoate backbone, indicating it is an ester derivative, and contains an amino group that is protected by a dimethylethoxycarbonyl (DMEC) moiety. The presence of the bromine atom suggests potential reactivity, making it useful in various chemical transformations. The stereochemistry at the 3-position is specified as (3S), indicating that it has a specific three-dimensional arrangement that can influence its biological activity and interactions. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could impart specific pharmacological properties. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular architecture, making it a candidate for further investigation in synthetic and medicinal chemistry contexts.
Formula:C13H24BrNO4
InChI:InChI=1S/C13H24BrNO4/c1-12(2,3)18-10(16)7-9(8-14)15-11(17)19-13(4,5)6/h9H,7-8H2,1-6H3,(H,15,17)/t9-/m0/s1
InChI key:InChIKey=YVZBCOHGRDGBDM-VIFPVBQESA-N
SMILES:C([C@H](NC(OC(C)(C)C)=O)CBr)C(OC(C)(C)C)=O
Synonyms:
  • 1,1-Dimethylethyl (3S)-4-bromo-3-[[(1,1-dimethylethoxy)carbonyl]amino]butanoate
  • Butanoic acid, 4-bromo-3-[[(1,1-dimethylethoxy)carbonyl]amino]-, 1,1-dimethylethyl ester, (3S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.